C20H22F2N6O3S — CID 67502511
5-[(2R)-2-(2,5-difluorophenyl)pyrrolidin-1-yl]-N-[2-(methanesulfonamido)ethyl]pyrazolo[1,5-a]pyrimidine-3-carboxamide (PubChem CID 67502511) has the molecular formula C20H22F2N6O3S and a molecular weight of 464.50 g/mol. Its IUPAC name is 5-[(2R)-2-(2,5-difluorophenyl)pyrrolidin-1-yl]-N-[2-(methanesulfonamido)ethyl]pyrazolo[1,5-a]pyrimidine-3-carboxamide.
| Compound Name | 5-[(2R)-2-(2,5-difluorophenyl)pyrrolidin-1-yl]-N-[2-(methanesulfonamido)ethyl]pyrazolo[1,5-a]pyrimidine-3-carboxamide |
|---|---|
| PubChem CID | 67502511 |
| Molecular Formula | C20H22F2N6O3S |
| Molecular Weight | 464.50 g/mol |
| Exact Mass | 464.14 |
| IUPAC Name | 5-[(2R)-2-(2,5-difluorophenyl)pyrrolidin-1-yl]-N-[2-(methanesulfonamido)ethyl]pyrazolo[1,5-a]pyrimidine-3-carboxamide |
| SMILES | CS(=O)(=O)NCCNC(=O)c1cnn2ccc(N3CCC[C@@H]3c3cc(F)ccc3F)nc12 |
| InChI | InChI=1S/C20H22F2N6O3S/c1-32(30,31)25-8-7-23-20(29)15-12-24-28-10-6-18(26-19(15)28)27-9-2-3-17(27)14-11-13(21)4-5-16(14)22/h4-6,10-12,17,25H,2-3,7-9H2,1H3,(H,23,29)/t17-/m1/s1 |
| InChIKey | VWMOKEZPLSLTCC-QGZVFWFLSA-N |
| XLogP | 1.63 |
| TPSA | 108.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.50 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|