C29H27N5 — CID 67502567
4-(3-methyl-4-quinolin-3-ylpyrrolo[2,3-b]pyridin-1-yl)-2-(pentylamino)benzonitrile (PubChem CID 67502567) has the molecular formula C29H27N5 and a molecular weight of 445.57 g/mol. Its IUPAC name is 4-(3-methyl-4-quinolin-3-ylpyrrolo[2,3-b]pyridin-1-yl)-2-(pentylamino)benzonitrile.
| Compound Name | 4-(3-methyl-4-quinolin-3-ylpyrrolo[2,3-b]pyridin-1-yl)-2-(pentylamino)benzonitrile |
|---|---|
| PubChem CID | 67502567 |
| Molecular Formula | C29H27N5 |
| Molecular Weight | 445.57 g/mol |
| Exact Mass | 445.23 |
| IUPAC Name | 4-(3-methyl-4-quinolin-3-ylpyrrolo[2,3-b]pyridin-1-yl)-2-(pentylamino)benzonitrile |
| SMILES | CCCCCNc1cc(-n2cc(C)c3c(-c4cnc5ccccc5c4)ccnc32)ccc1C#N |
| InChI | InChI=1S/C29H27N5/c1-3-4-7-13-31-27-16-24(11-10-22(27)17-30)34-19-20(2)28-25(12-14-32-29(28)34)23-15-21-8-5-6-9-26(21)33-18-23/h5-6,8-12,14-16,18-19,31H,3-4,7,13H2,1-2H3 |
| InChIKey | DJSQPPGYJBEDNR-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 66.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.57 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|