C42H39N5O3 — CID 67503023
tert-butyl-[1-[4-[4-(4-phenylmethoxyphenyl)-2,5,13,15-tetrazatetracyclo[12.4.0.02,6.07,12]octadeca-1(14),3,5,7,9,11,15,17-octaen-3-yl]phenyl]cyclobutyl]carbamic acid (PubChem CID 67503023) has the molecular formula C42H39N5O3 and a molecular weight of 661.81 g/mol. Its IUPAC name is tert-butyl-[1-[4-[4-(4-phenylmethoxyphenyl)-2,5,13,15-tetrazatetracyclo[12.4.0.02,6.07,12]octadeca-1(14),3,5,7,9,11,15,17-octaen-3-yl]phenyl]cyclobutyl]carbamic acid.
| Compound Name | tert-butyl-[1-[4-[4-(4-phenylmethoxyphenyl)-2,5,13,15-tetrazatetracyclo[12.4.0.02,6.07,12]octadeca-1(14),3,5,7,9,11,15,17-octaen-3-yl]phenyl]cyclobutyl]carbamic acid |
|---|---|
| PubChem CID | 67503023 |
| Molecular Formula | C42H39N5O3 |
| Molecular Weight | 661.81 g/mol |
| Exact Mass | 661.31 |
| IUPAC Name | tert-butyl-[1-[4-[4-(4-phenylmethoxyphenyl)-2,5,13,15-tetrazatetracyclo[12.4.0.02,6.07,12]octadeca-1(14),3,5,7,9,11,15,17-octaen-3-yl]phenyl]cyclobutyl]carbamic acid |
| SMILES | CC(C)(C)N(C(=O)O)C1(c2ccc(-c3c(-c4ccc(OCc5ccccc5)cc4)nc4n3-c3cccnc3Nc3ccccc3-4)cc2)CCC1 |
| InChI | InChI=1S/C42H39N5O3/c1-41(2,3)47(40(48)49)42(24-10-25-42)31-20-16-30(17-21-31)37-36(29-18-22-32(23-19-29)50-27-28-11-5-4-6-12-28)45-39-33-13-7-8-14-34(33)44-38-35(46(37)39)15-9-26-43-38/h4-9,11-23,26H,10,24-25,27H2,1-3H3,(H,43,44)(H,48,49) |
| InChIKey | VXUSVEDIILWNMH-UHFFFAOYSA-N |
| XLogP | 10.06 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.81 |
| LogP ≤ 5 | 10.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |