C27H27ClFN5O3 — CID 67503078
2-(2-chloro-6-fluoroanilino)-N-[6-(cyclopropylmethoxy)-3-pyridinyl]-7,7-dimethyl-1,2,3,8-tetrahydrofuro[3,2-e]benzimidazole-5-carboxamide (PubChem CID 67503078) has the molecular formula C27H27ClFN5O3 and a molecular weight of 524.00 g/mol. Its IUPAC name is 2-(2-chloro-6-fluoroanilino)-N-[6-(cyclopropylmethoxy)-3-pyridinyl]-7,7-dimethyl-1,2,3,8-tetrahydrofuro[3,2-e]benzimidazole-5-carboxamide.
| Compound Name | 2-(2-chloro-6-fluoroanilino)-N-[6-(cyclopropylmethoxy)-3-pyridinyl]-7,7-dimethyl-1,2,3,8-tetrahydrofuro[3,2-e]benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 67503078 |
| Molecular Formula | C27H27ClFN5O3 |
| Molecular Weight | 524.00 g/mol |
| Exact Mass | 523.18 |
| IUPAC Name | 2-(2-chloro-6-fluoroanilino)-N-[6-(cyclopropylmethoxy)-3-pyridinyl]-7,7-dimethyl-1,2,3,8-tetrahydrofuro[3,2-e]benzimidazole-5-carboxamide |
| SMILES | CC1(C)Cc2c3c(cc(C(=O)Nc4ccc(OCC5CC5)nc4)c2O1)NC(Nc1c(F)cccc1Cl)N3 |
| InChI | InChI=1S/C27H27ClFN5O3/c1-27(2)11-17-22-20(32-26(33-22)34-23-18(28)4-3-5-19(23)29)10-16(24(17)37-27)25(35)31-15-8-9-21(30-12-15)36-13-14-6-7-14/h3-5,8-10,12,14,26,32-34H,6-7,11,13H2,1-2H3,(H,31,35) |
| InChIKey | SIBHYIVLRCNYPK-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 96.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.00 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|