C24H21ClF3N5O3 — CID 67503314
2-(2-chloro-6-fluoroanilino)-N-[6-(difluoromethoxy)-3-pyridinyl]-7,7-dimethyl-1,2,3,8-tetrahydrofuro[3,2-e]benzimidazole-5-carboxamide (PubChem CID 67503314) has the molecular formula C24H21ClF3N5O3 and a molecular weight of 519.91 g/mol. Its IUPAC name is 2-(2-chloro-6-fluoroanilino)-N-[6-(difluoromethoxy)-3-pyridinyl]-7,7-dimethyl-1,2,3,8-tetrahydrofuro[3,2-e]benzimidazole-5-carboxamide.
| Compound Name | 2-(2-chloro-6-fluoroanilino)-N-[6-(difluoromethoxy)-3-pyridinyl]-7,7-dimethyl-1,2,3,8-tetrahydrofuro[3,2-e]benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 67503314 |
| Molecular Formula | C24H21ClF3N5O3 |
| Molecular Weight | 519.91 g/mol |
| Exact Mass | 519.13 |
| IUPAC Name | 2-(2-chloro-6-fluoroanilino)-N-[6-(difluoromethoxy)-3-pyridinyl]-7,7-dimethyl-1,2,3,8-tetrahydrofuro[3,2-e]benzimidazole-5-carboxamide |
| SMILES | CC1(C)Cc2c3c(cc(C(=O)Nc4ccc(OC(F)F)nc4)c2O1)NC(Nc1c(F)cccc1Cl)N3 |
| InChI | InChI=1S/C24H21ClF3N5O3/c1-24(2)9-13-18-16(31-23(32-18)33-19-14(25)4-3-5-15(19)26)8-12(20(13)36-24)21(34)30-11-6-7-17(29-10-11)35-22(27)28/h3-8,10,22-23,31-33H,9H2,1-2H3,(H,30,34) |
| InChIKey | JEDULJNJYYWYFR-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 96.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.91 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|