C32H25N5O — CID 67503427
1-[4-[4-(1-benzofuran-2-yl)-2,5,13,15-tetrazatetracyclo[12.4.0.02,6.07,12]octadeca-1(14),3,5,7,9,11,15,17-octaen-3-yl]phenyl]cyclobutan-1-amine (PubChem CID 67503427) has the molecular formula C32H25N5O and a molecular weight of 495.59 g/mol. Its IUPAC name is 1-[4-[4-(1-benzofuran-2-yl)-2,5,13,15-tetrazatetracyclo[12.4.0.02,6.07,12]octadeca-1(14),3,5,7,9,11,15,17-octaen-3-yl]phenyl]cyclobutan-1-amine.
| Compound Name | 1-[4-[4-(1-benzofuran-2-yl)-2,5,13,15-tetrazatetracyclo[12.4.0.02,6.07,12]octadeca-1(14),3,5,7,9,11,15,17-octaen-3-yl]phenyl]cyclobutan-1-amine |
|---|---|
| PubChem CID | 67503427 |
| Molecular Formula | C32H25N5O |
| Molecular Weight | 495.59 g/mol |
| Exact Mass | 495.21 |
| IUPAC Name | 1-[4-[4-(1-benzofuran-2-yl)-2,5,13,15-tetrazatetracyclo[12.4.0.02,6.07,12]octadeca-1(14),3,5,7,9,11,15,17-octaen-3-yl]phenyl]cyclobutan-1-amine |
| SMILES | NC1(c2ccc(-c3c(-c4cc5ccccc5o4)nc4n3-c3cccnc3Nc3ccccc3-4)cc2)CCC1 |
| InChI | InChI=1S/C32H25N5O/c33-32(16-6-17-32)22-14-12-20(13-15-22)29-28(27-19-21-7-1-4-11-26(21)38-27)36-31-23-8-2-3-9-24(23)35-30-25(37(29)31)10-5-18-34-30/h1-5,7-15,18-19H,6,16-17,33H2,(H,34,35) |
| InChIKey | QIMBLVUMEWHWMN-UHFFFAOYSA-N |
| XLogP | 7.41 |
| TPSA | 81.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.59 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |