C23H20Cl2FN5O2 — CID 67503450
2-(2-chloro-6-fluoroanilino)-N-(5-chloro-2-pyridinyl)-7,7-dimethyl-1,2,3,8-tetrahydrofuro[3,2-e]benzimidazole-5-carboxamide (PubChem CID 67503450) has the molecular formula C23H20Cl2FN5O2 and a molecular weight of 488.35 g/mol. Its IUPAC name is 2-(2-chloro-6-fluoroanilino)-N-(5-chloro-2-pyridinyl)-7,7-dimethyl-1,2,3,8-tetrahydrofuro[3,2-e]benzimidazole-5-carboxamide.
| Compound Name | 2-(2-chloro-6-fluoroanilino)-N-(5-chloro-2-pyridinyl)-7,7-dimethyl-1,2,3,8-tetrahydrofuro[3,2-e]benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 67503450 |
| Molecular Formula | C23H20Cl2FN5O2 |
| Molecular Weight | 488.35 g/mol |
| Exact Mass | 487.10 |
| IUPAC Name | 2-(2-chloro-6-fluoroanilino)-N-(5-chloro-2-pyridinyl)-7,7-dimethyl-1,2,3,8-tetrahydrofuro[3,2-e]benzimidazole-5-carboxamide |
| SMILES | CC1(C)Cc2c3c(cc(C(=O)Nc4ccc(Cl)cn4)c2O1)NC(Nc1c(F)cccc1Cl)N3 |
| InChI | InChI=1S/C23H20Cl2FN5O2/c1-23(2)9-13-18-16(28-22(30-18)31-19-14(25)4-3-5-15(19)26)8-12(20(13)33-23)21(32)29-17-7-6-11(24)10-27-17/h3-8,10,22,28,30-31H,9H2,1-2H3,(H,27,29,32) |
| InChIKey | RSTUULILEVLFGD-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 87.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.35 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|