C24H20ClF4N5O2 — CID 67503465
2-(2-chloro-6-fluoroanilino)-7,7-dimethyl-N-[5-(trifluoromethyl)-2-pyridinyl]-1,2,3,8-tetrahydrofuro[3,2-e]benzimidazole-5-carboxamide (PubChem CID 67503465) has the molecular formula C24H20ClF4N5O2 and a molecular weight of 521.90 g/mol. Its IUPAC name is 2-(2-chloro-6-fluoroanilino)-7,7-dimethyl-N-[5-(trifluoromethyl)-2-pyridinyl]-1,2,3,8-tetrahydrofuro[3,2-e]benzimidazole-5-carboxamide.
| Compound Name | 2-(2-chloro-6-fluoroanilino)-7,7-dimethyl-N-[5-(trifluoromethyl)-2-pyridinyl]-1,2,3,8-tetrahydrofuro[3,2-e]benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 67503465 |
| Molecular Formula | C24H20ClF4N5O2 |
| Molecular Weight | 521.90 g/mol |
| Exact Mass | 521.12 |
| IUPAC Name | 2-(2-chloro-6-fluoroanilino)-7,7-dimethyl-N-[5-(trifluoromethyl)-2-pyridinyl]-1,2,3,8-tetrahydrofuro[3,2-e]benzimidazole-5-carboxamide |
| SMILES | CC1(C)Cc2c3c(cc(C(=O)Nc4ccc(C(F)(F)F)cn4)c2O1)NC(Nc1c(F)cccc1Cl)N3 |
| InChI | InChI=1S/C24H20ClF4N5O2/c1-23(2)9-13-18-16(31-22(33-18)34-19-14(25)4-3-5-15(19)26)8-12(20(13)36-23)21(35)32-17-7-6-11(10-30-17)24(27,28)29/h3-8,10,22,31,33-34H,9H2,1-2H3,(H,30,32,35) |
| InChIKey | HAGRQYORMDBTMX-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 87.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.90 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|