C24H22Cl2FN5O2 — CID 67503691
2-[(3,5-dichloro-4-pyridinyl)amino]-N-[(4-fluorophenyl)methyl]-7,7-dimethyl-1,2,3,8-tetrahydrofuro[3,2-e]benzimidazole-5-carboxamide (PubChem CID 67503691) has the molecular formula C24H22Cl2FN5O2 and a molecular weight of 502.38 g/mol. Its IUPAC name is 2-[(3,5-dichloro-4-pyridinyl)amino]-N-[(4-fluorophenyl)methyl]-7,7-dimethyl-1,2,3,8-tetrahydrofuro[3,2-e]benzimidazole-5-carboxamide.
| Compound Name | 2-[(3,5-dichloro-4-pyridinyl)amino]-N-[(4-fluorophenyl)methyl]-7,7-dimethyl-1,2,3,8-tetrahydrofuro[3,2-e]benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 67503691 |
| Molecular Formula | C24H22Cl2FN5O2 |
| Molecular Weight | 502.38 g/mol |
| Exact Mass | 501.11 |
| IUPAC Name | 2-[(3,5-dichloro-4-pyridinyl)amino]-N-[(4-fluorophenyl)methyl]-7,7-dimethyl-1,2,3,8-tetrahydrofuro[3,2-e]benzimidazole-5-carboxamide |
| SMILES | CC1(C)Cc2c3c(cc(C(=O)NCc4ccc(F)cc4)c2O1)NC(Nc1c(Cl)cncc1Cl)N3 |
| InChI | InChI=1S/C24H22Cl2FN5O2/c1-24(2)8-15-19-18(30-23(31-19)32-20-16(25)10-28-11-17(20)26)7-14(21(15)34-24)22(33)29-9-12-3-5-13(27)6-4-12/h3-7,10-11,23,30-31H,8-9H2,1-2H3,(H,28,32)(H,29,33) |
| InChIKey | BNWDDTASVUJEOV-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 87.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.38 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|