C32H24N6O3 — CID 67503701
[1-[4-[4-(1,3-benzoxazol-2-yl)-2,5,13,15-tetrazatetracyclo[12.4.0.02,6.07,12]octadeca-1(14),3,5,7,9,11,15,17-octaen-3-yl]phenyl]cyclobutyl]carbamic acid (PubChem CID 67503701) has the molecular formula C32H24N6O3 and a molecular weight of 540.58 g/mol. Its IUPAC name is [1-[4-[4-(1,3-benzoxazol-2-yl)-2,5,13,15-tetrazatetracyclo[12.4.0.02,6.07,12]octadeca-1(14),3,5,7,9,11,15,17-octaen-3-yl]phenyl]cyclobutyl]carbamic acid.
| Compound Name | [1-[4-[4-(1,3-benzoxazol-2-yl)-2,5,13,15-tetrazatetracyclo[12.4.0.02,6.07,12]octadeca-1(14),3,5,7,9,11,15,17-octaen-3-yl]phenyl]cyclobutyl]carbamic acid |
|---|---|
| PubChem CID | 67503701 |
| Molecular Formula | C32H24N6O3 |
| Molecular Weight | 540.58 g/mol |
| Exact Mass | 540.19 |
| IUPAC Name | [1-[4-[4-(1,3-benzoxazol-2-yl)-2,5,13,15-tetrazatetracyclo[12.4.0.02,6.07,12]octadeca-1(14),3,5,7,9,11,15,17-octaen-3-yl]phenyl]cyclobutyl]carbamic acid |
| SMILES | O=C(O)NC1(c2ccc(-c3c(-c4nc5ccccc5o4)nc4n3-c3cccnc3Nc3ccccc3-4)cc2)CCC1 |
| InChI | InChI=1S/C32H24N6O3/c39-31(40)37-32(16-6-17-32)20-14-12-19(13-15-20)27-26(30-35-23-9-3-4-11-25(23)41-30)36-29-21-7-1-2-8-22(21)34-28-24(38(27)29)10-5-18-33-28/h1-5,7-15,18,37H,6,16-17H2,(H,33,34)(H,39,40) |
| InChIKey | KKDBRUMTKAELMB-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 118.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.58 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |