About 4-prop-2-enyl-1,2-oxazol-3-one
4-prop-2-enyl-1,2-oxazol-3-one (PubChem CID 67503813) has the molecular formula C6H7NO2
and a molecular weight of 125.13 g/mol. Its IUPAC name is 4-prop-2-enyl-1,2-oxazol-3-one.
Molecular Properties
| Compound Name | 4-prop-2-enyl-1,2-oxazol-3-one |
| PubChem CID | 67503813 |
| Molecular Formula | C6H7NO2 |
| Molecular Weight | 125.13 g/mol |
| Exact Mass | 125.05 |
| IUPAC Name | 4-prop-2-enyl-1,2-oxazol-3-one |
| SMILES | C=CCc1co[nH]c1=O |
| InChI | InChI=1S/C6H7NO2/c1-2-3-5-4-9-7-6(5)8/h2,4H,1,3H2,(H,7,8) |
| InChIKey | RIGOCRYQIPJHNS-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 46.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 125.13 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-prop-2-enyl-1,2-oxazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-prop-2-enyl-1,2-oxazol-3-one?
The IUPAC name of 4-prop-2-enyl-1,2-oxazol-3-one (CID 67503813) is 4-prop-2-enyl-1,2-oxazol-3-one.
What is the SMILES notation for 4-prop-2-enyl-1,2-oxazol-3-one?
The canonical SMILES for 4-prop-2-enyl-1,2-oxazol-3-one is C=CCc1co[nH]c1=O.
What is the InChIKey of 4-prop-2-enyl-1,2-oxazol-3-one?
The InChIKey is RIGOCRYQIPJHNS-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7NO2/c1-2-3-5-4-9-7-6(5)8/h2,4H,1,3H2,(H,7,8).
What are the key properties of 4-prop-2-enyl-1,2-oxazol-3-one?
4-prop-2-enyl-1,2-oxazol-3-one has a molecular weight of 125.13 g/mol, XLogP of 0.70, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-prop-2-enyl-1,2-oxazol-3-one is sourced from PubChem (CID 67503813), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).