C35H28N6 — CID 67503839
1-[4-[4-(4-pyridin-4-ylphenyl)-2,5,13,15-tetrazatetracyclo[12.4.0.02,6.07,12]octadeca-1(14),3,5,7,9,11,15,17-octaen-3-yl]phenyl]cyclobutan-1-amine (PubChem CID 67503839) has the molecular formula C35H28N6 and a molecular weight of 532.65 g/mol. Its IUPAC name is 1-[4-[4-(4-pyridin-4-ylphenyl)-2,5,13,15-tetrazatetracyclo[12.4.0.02,6.07,12]octadeca-1(14),3,5,7,9,11,15,17-octaen-3-yl]phenyl]cyclobutan-1-amine.
| Compound Name | 1-[4-[4-(4-pyridin-4-ylphenyl)-2,5,13,15-tetrazatetracyclo[12.4.0.02,6.07,12]octadeca-1(14),3,5,7,9,11,15,17-octaen-3-yl]phenyl]cyclobutan-1-amine |
|---|---|
| PubChem CID | 67503839 |
| Molecular Formula | C35H28N6 |
| Molecular Weight | 532.65 g/mol |
| Exact Mass | 532.24 |
| IUPAC Name | 1-[4-[4-(4-pyridin-4-ylphenyl)-2,5,13,15-tetrazatetracyclo[12.4.0.02,6.07,12]octadeca-1(14),3,5,7,9,11,15,17-octaen-3-yl]phenyl]cyclobutan-1-amine |
| SMILES | NC1(c2ccc(-c3c(-c4ccc(-c5ccncc5)cc4)nc4n3-c3cccnc3Nc3ccccc3-4)cc2)CCC1 |
| InChI | InChI=1S/C35H28N6/c36-35(18-4-19-35)27-14-12-26(13-15-27)32-31(25-10-8-23(9-11-25)24-16-21-37-22-17-24)40-34-28-5-1-2-6-29(28)39-33-30(41(32)34)7-3-20-38-33/h1-3,5-17,20-22H,4,18-19,36H2,(H,38,39) |
| InChIKey | FUUMRKNAGCSXJD-UHFFFAOYSA-N |
| XLogP | 7.73 |
| TPSA | 81.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.65 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |