C11H12N4S — CID 675042
2-benzylsulfanylpyrimidine-4,6-diamine (PubChem CID 675042) has the molecular formula C11H12N4S and a molecular weight of 232.31 g/mol. Its IUPAC name is 2-benzylsulfanylpyrimidine-4,6-diamine.
| Compound Name | 2-benzylsulfanylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 675042 |
| Molecular Formula | C11H12N4S |
| Molecular Weight | 232.31 g/mol |
| Exact Mass | 232.08 |
| IUPAC Name | 2-benzylsulfanylpyrimidine-4,6-diamine |
| SMILES | Nc1cc(N)nc(SCc2ccccc2)n1 |
| InChI | InChI=1S/C11H12N4S/c12-9-6-10(13)15-11(14-9)16-7-8-4-2-1-3-5-8/h1-6H,7H2,(H4,12,13,14,15) |
| InChIKey | DAZJCNWHHPUGCC-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 77.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.31 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |