C25H21N5O2 — CID 67504236
[1-[4-(2,5,13,15-tetrazatetracyclo[12.4.0.02,6.07,12]octadeca-1(14),3,5,7,9,11,15,17-octaen-3-yl)phenyl]cyclobutyl]carbamic acid (PubChem CID 67504236) has the molecular formula C25H21N5O2 and a molecular weight of 423.48 g/mol. Its IUPAC name is [1-[4-(2,5,13,15-tetrazatetracyclo[12.4.0.02,6.07,12]octadeca-1(14),3,5,7,9,11,15,17-octaen-3-yl)phenyl]cyclobutyl]carbamic acid.
| Compound Name | [1-[4-(2,5,13,15-tetrazatetracyclo[12.4.0.02,6.07,12]octadeca-1(14),3,5,7,9,11,15,17-octaen-3-yl)phenyl]cyclobutyl]carbamic acid |
|---|---|
| PubChem CID | 67504236 |
| Molecular Formula | C25H21N5O2 |
| Molecular Weight | 423.48 g/mol |
| Exact Mass | 423.17 |
| IUPAC Name | [1-[4-(2,5,13,15-tetrazatetracyclo[12.4.0.02,6.07,12]octadeca-1(14),3,5,7,9,11,15,17-octaen-3-yl)phenyl]cyclobutyl]carbamic acid |
| SMILES | O=C(O)NC1(c2ccc(-c3cnc4n3-c3cccnc3Nc3ccccc3-4)cc2)CCC1 |
| InChI | InChI=1S/C25H21N5O2/c31-24(32)29-25(12-4-13-25)17-10-8-16(9-11-17)21-15-27-23-18-5-1-2-6-19(18)28-22-20(30(21)23)7-3-14-26-22/h1-3,5-11,14-15,29H,4,12-13H2,(H,26,28)(H,31,32) |
| InChIKey | BOTGQYOOZGKSNQ-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 92.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.48 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |