C9H12N4O2 — CID 67505348
1,3,4,8-tetramethylpurine-2,6-dione (PubChem CID 67505348) has the molecular formula C9H12N4O2 and a molecular weight of 208.22 g/mol. Its IUPAC name is 1,3,4,8-tetramethylpurine-2,6-dione.
| Compound Name | 1,3,4,8-tetramethylpurine-2,6-dione |
|---|---|
| PubChem CID | 67505348 |
| Molecular Formula | C9H12N4O2 |
| Molecular Weight | 208.22 g/mol |
| Exact Mass | 208.10 |
| IUPAC Name | 1,3,4,8-tetramethylpurine-2,6-dione |
| SMILES | CC1=NC2(C)C(=N1)C(=O)N(C)C(=O)N2C |
| InChI | InChI=1S/C9H12N4O2/c1-5-10-6-7(14)12(3)8(15)13(4)9(6,2)11-5/h1-4H3 |
| InChIKey | WIQFGKRTJPLYOE-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 65.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.22 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |