C24H25N5O3S — CID 67505358
5-(1,1-dioxothian-4-yl)-6-(1-ethoxyethenyl)-3-quinolin-3-ylpyrazolo[1,5-a]pyrimidin-7-amine (PubChem CID 67505358) has the molecular formula C24H25N5O3S and a molecular weight of 463.56 g/mol. Its IUPAC name is 5-(1,1-dioxothian-4-yl)-6-(1-ethoxyethenyl)-3-quinolin-3-ylpyrazolo[1,5-a]pyrimidin-7-amine.
| Compound Name | 5-(1,1-dioxothian-4-yl)-6-(1-ethoxyethenyl)-3-quinolin-3-ylpyrazolo[1,5-a]pyrimidin-7-amine |
|---|---|
| PubChem CID | 67505358 |
| Molecular Formula | C24H25N5O3S |
| Molecular Weight | 463.56 g/mol |
| Exact Mass | 463.17 |
| IUPAC Name | 5-(1,1-dioxothian-4-yl)-6-(1-ethoxyethenyl)-3-quinolin-3-ylpyrazolo[1,5-a]pyrimidin-7-amine |
| SMILES | C=C(OCC)c1c(C2CCS(=O)(=O)CC2)nc2c(-c3cnc4ccccc4c3)cnn2c1N |
| InChI | InChI=1S/C24H25N5O3S/c1-3-32-15(2)21-22(16-8-10-33(30,31)11-9-16)28-24-19(14-27-29(24)23(21)25)18-12-17-6-4-5-7-20(17)26-13-18/h4-7,12-14,16H,2-3,8-11,25H2,1H3 |
| InChIKey | QBKMBKLXJHSOTO-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 112.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.56 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|