C16H21F2NO2 — CID 67505810
tert-butyl 4,4-difluoro-2-phenylpiperidine-1-carboxylate (PubChem CID 67505810) has the molecular formula C16H21F2NO2 and a molecular weight of 297.34 g/mol. Its IUPAC name is tert-butyl 4,4-difluoro-2-phenylpiperidine-1-carboxylate.
| Compound Name | tert-butyl 4,4-difluoro-2-phenylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 67505810 |
| Molecular Formula | C16H21F2NO2 |
| Molecular Weight | 297.34 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | tert-butyl 4,4-difluoro-2-phenylpiperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(F)(F)CC1c1ccccc1 |
| InChI | InChI=1S/C16H21F2NO2/c1-15(2,3)21-14(20)19-10-9-16(17,18)11-13(19)12-7-5-4-6-8-12/h4-8,13H,9-11H2,1-3H3 |
| InChIKey | GVUDLANFFFNCFL-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.34 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |