About 2,7-bis(3,5-dimethyl-1-adamantyl)fluoren-1-one
2,7-bis(3,5-dimethyl-1-adamantyl)fluoren-1-one (PubChem CID 67506106) has the molecular formula C37H44O
and a molecular weight of 504.76 g/mol. Its IUPAC name is 2,7-bis(3,5-dimethyl-1-adamantyl)fluoren-1-one.
Molecular Properties
| Compound Name | 2,7-bis(3,5-dimethyl-1-adamantyl)fluoren-1-one |
| PubChem CID | 67506106 |
| Molecular Formula | C37H44O |
| Molecular Weight | 504.76 g/mol |
| Exact Mass | 504.34 |
| IUPAC Name | 2,7-bis(3,5-dimethyl-1-adamantyl)fluoren-1-one |
| SMILES | CC12CC3CC(C)(C1)CC(C1=CC=C4C(=Cc5cc(C67CC8CC(C)(CC(C)(C8)C6)C7)ccc54)C1=O)(C3)C2 |
| InChI | InChI=1S/C37H44O/c1-32-11-23-12-33(2,17-32)20-36(15-23,19-32)26-5-6-27-25(9-26)10-29-28(27)7-8-30(31(29)38)37-16-24-13-34(3,21-37)18-35(4,14-24)22-37/h5-10,23-24H,11-22H2,1-4H3 |
| InChIKey | SQZWSIKXJRMRES-UHFFFAOYSA-N |
| XLogP | 9.22 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 504.76 |
| LogP ≤ 5 | 9.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,7-bis(3,5-dimethyl-1-adamantyl)fluoren-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,7-bis(3,5-dimethyl-1-adamantyl)fluoren-1-one?
The IUPAC name of 2,7-bis(3,5-dimethyl-1-adamantyl)fluoren-1-one (CID 67506106) is 2,7-bis(3,5-dimethyl-1-adamantyl)fluoren-1-one.
What is the SMILES notation for 2,7-bis(3,5-dimethyl-1-adamantyl)fluoren-1-one?
The canonical SMILES for 2,7-bis(3,5-dimethyl-1-adamantyl)fluoren-1-one is CC12CC3CC(C)(C1)CC(C1=CC=C4C(=Cc5cc(C67CC8CC(C)(CC(C)(C8)C6)C7)ccc54)C1=O)(C3)C2.
What is the InChIKey of 2,7-bis(3,5-dimethyl-1-adamantyl)fluoren-1-one?
The InChIKey is SQZWSIKXJRMRES-UHFFFAOYSA-N. The full InChI is InChI=1S/C37H44O/c1-32-11-23-12-33(2,17-32)20-36(15-23,19-32)26-5-6-27-25(9-26)10-29-28(27)7-8-30(31(29)38)37-16-24-13-34(3,21-37)18-35(4,14-24)22-37/h5-10,23-24H,11-22H2,1-4H3.
What are the key properties of 2,7-bis(3,5-dimethyl-1-adamantyl)fluoren-1-one?
2,7-bis(3,5-dimethyl-1-adamantyl)fluoren-1-one has a molecular weight of 504.76 g/mol, XLogP of 9.22, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,7-bis(3,5-dimethyl-1-adamantyl)fluoren-1-one is sourced from PubChem (CID 67506106), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).