About 4-(2-methylpropyl)-2,3-diphenylbenzenethiol
4-(2-methylpropyl)-2,3-diphenylbenzenethiol (PubChem CID 67506958) has the molecular formula C22H22S
and a molecular weight of 318.49 g/mol. Its IUPAC name is 4-(2-methylpropyl)-2,3-diphenylbenzenethiol.
Molecular Properties
| Compound Name | 4-(2-methylpropyl)-2,3-diphenylbenzenethiol |
| PubChem CID | 67506958 |
| Molecular Formula | C22H22S |
| Molecular Weight | 318.49 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | 4-(2-methylpropyl)-2,3-diphenylbenzenethiol |
| SMILES | CC(C)Cc1ccc(S)c(-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C22H22S/c1-16(2)15-19-13-14-20(23)22(18-11-7-4-8-12-18)21(19)17-9-5-3-6-10-17/h3-14,16,23H,15H2,1-2H3 |
| InChIKey | DLPSBEQARNZSMT-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 318.49 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 4-(2-methylpropyl)-2,3-diphenylbenzenethiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-methylpropyl)-2,3-diphenylbenzenethiol?
The IUPAC name of 4-(2-methylpropyl)-2,3-diphenylbenzenethiol (CID 67506958) is 4-(2-methylpropyl)-2,3-diphenylbenzenethiol.
What is the SMILES notation for 4-(2-methylpropyl)-2,3-diphenylbenzenethiol?
The canonical SMILES for 4-(2-methylpropyl)-2,3-diphenylbenzenethiol is CC(C)Cc1ccc(S)c(-c2ccccc2)c1-c1ccccc1.
What is the InChIKey of 4-(2-methylpropyl)-2,3-diphenylbenzenethiol?
The InChIKey is DLPSBEQARNZSMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H22S/c1-16(2)15-19-13-14-20(23)22(18-11-7-4-8-12-18)21(19)17-9-5-3-6-10-17/h3-14,16,23H,15H2,1-2H3.
What are the key properties of 4-(2-methylpropyl)-2,3-diphenylbenzenethiol?
4-(2-methylpropyl)-2,3-diphenylbenzenethiol has a molecular weight of 318.49 g/mol, XLogP of 6.51, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-methylpropyl)-2,3-diphenylbenzenethiol is sourced from PubChem (CID 67506958), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).