2-(4-methyl-1,3-thiazol-2-yl)ethylcarbamic acid

C7H10N2O2S — CID 67507576

IUPAC2-(4-methyl-1,3-thiazol-2-yl)ethylcarbamic acid
SMILESCc1csc(CCNC(=O)O)n1
InChIInChI=1S/C7H10N2O2S/c1-5-4-12-6(9-5)2-3-8-7(10)11/h4,8H,2-3H2,1H3,(H,10,11)
InChIKeyPRKRULSFUTYQRQ-UHFFFAOYSA-N
MW186.24 g/mol
LogP1.26
Rot. Bonds3

About 2-(4-methyl-1,3-thiazol-2-yl)ethylcarbamic acid

2-(4-methyl-1,3-thiazol-2-yl)ethylcarbamic acid (PubChem CID 67507576) has the molecular formula C7H10N2O2S and a molecular weight of 186.24 g/mol. Its IUPAC name is 2-(4-methyl-1,3-thiazol-2-yl)ethylcarbamic acid.

Molecular Properties

Compound Name2-(4-methyl-1,3-thiazol-2-yl)ethylcarbamic acid
PubChem CID67507576
Molecular FormulaC7H10N2O2S
Molecular Weight186.24 g/mol
Exact Mass186.05
IUPAC Name2-(4-methyl-1,3-thiazol-2-yl)ethylcarbamic acid
SMILESCc1csc(CCNC(=O)O)n1
InChIInChI=1S/C7H10N2O2S/c1-5-4-12-6(9-5)2-3-8-7(10)11/h4,8H,2-3H2,1H3,(H,10,11)
InChIKeyPRKRULSFUTYQRQ-UHFFFAOYSA-N
XLogP1.26
TPSA62.22 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500186.24
LogP ≤ 51.26
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 2-(4-methyl-1,3-thiazol-2-yl)ethylcarbamic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(4-methyl-1,3-thiazol-2-yl)ethylcarbamic acid?
The IUPAC name of 2-(4-methyl-1,3-thiazol-2-yl)ethylcarbamic acid (CID 67507576) is 2-(4-methyl-1,3-thiazol-2-yl)ethylcarbamic acid.
What is the SMILES notation for 2-(4-methyl-1,3-thiazol-2-yl)ethylcarbamic acid?
The canonical SMILES for 2-(4-methyl-1,3-thiazol-2-yl)ethylcarbamic acid is Cc1csc(CCNC(=O)O)n1.
What is the InChIKey of 2-(4-methyl-1,3-thiazol-2-yl)ethylcarbamic acid?
The InChIKey is PRKRULSFUTYQRQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2O2S/c1-5-4-12-6(9-5)2-3-8-7(10)11/h4,8H,2-3H2,1H3,(H,10,11).
What are the key properties of 2-(4-methyl-1,3-thiazol-2-yl)ethylcarbamic acid?
2-(4-methyl-1,3-thiazol-2-yl)ethylcarbamic acid has a molecular weight of 186.24 g/mol, XLogP of 1.26, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-methyl-1,3-thiazol-2-yl)ethylcarbamic acid is sourced from PubChem (CID 67507576), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).