About cyclohexyl-(2,4-dimethoxy-3-phenylphenyl)phosphane
cyclohexyl-(2,4-dimethoxy-3-phenylphenyl)phosphane (PubChem CID 67507588) has the molecular formula C20H25O2P
and a molecular weight of 328.39 g/mol. Its IUPAC name is cyclohexyl-(2,4-dimethoxy-3-phenylphenyl)phosphane.
Molecular Properties
| Compound Name | cyclohexyl-(2,4-dimethoxy-3-phenylphenyl)phosphane |
| PubChem CID | 67507588 |
| Molecular Formula | C20H25O2P |
| Molecular Weight | 328.39 g/mol |
| Exact Mass | 328.16 |
| IUPAC Name | cyclohexyl-(2,4-dimethoxy-3-phenylphenyl)phosphane |
| SMILES | COc1ccc(PC2CCCCC2)c(OC)c1-c1ccccc1 |
| InChI | InChI=1S/C20H25O2P/c1-21-17-13-14-18(23-16-11-7-4-8-12-16)20(22-2)19(17)15-9-5-3-6-10-15/h3,5-6,9-10,13-14,16,23H,4,7-8,11-12H2,1-2H3 |
| InChIKey | UEHKLVIROJSIED-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 328.39 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze cyclohexyl-(2,4-dimethoxy-3-phenylphenyl)phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexyl-(2,4-dimethoxy-3-phenylphenyl)phosphane?
The IUPAC name of cyclohexyl-(2,4-dimethoxy-3-phenylphenyl)phosphane (CID 67507588) is cyclohexyl-(2,4-dimethoxy-3-phenylphenyl)phosphane.
What is the SMILES notation for cyclohexyl-(2,4-dimethoxy-3-phenylphenyl)phosphane?
The canonical SMILES for cyclohexyl-(2,4-dimethoxy-3-phenylphenyl)phosphane is COc1ccc(PC2CCCCC2)c(OC)c1-c1ccccc1.
What is the InChIKey of cyclohexyl-(2,4-dimethoxy-3-phenylphenyl)phosphane?
The InChIKey is UEHKLVIROJSIED-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H25O2P/c1-21-17-13-14-18(23-16-11-7-4-8-12-16)20(22-2)19(17)15-9-5-3-6-10-15/h3,5-6,9-10,13-14,16,23H,4,7-8,11-12H2,1-2H3.
What are the key properties of cyclohexyl-(2,4-dimethoxy-3-phenylphenyl)phosphane?
cyclohexyl-(2,4-dimethoxy-3-phenylphenyl)phosphane has a molecular weight of 328.39 g/mol, XLogP of 5.01, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexyl-(2,4-dimethoxy-3-phenylphenyl)phosphane is sourced from PubChem (CID 67507588), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).