About 1-N'-[5-(2-aminoethylcarbamoyl)-2-pyridinyl]-1-N'-cyclopropylcyclopropane-1,1-dicarboxamide
1-N'-[5-(2-aminoethylcarbamoyl)-2-pyridinyl]-1-N'-cyclopropylcyclopropane-1,1-dicarboxamide (PubChem CID 67507894) has the molecular formula C16H21N5O3
and a molecular weight of 331.38 g/mol. Its IUPAC name is 1-N'-[5-(2-aminoethylcarbamoyl)-2-pyridinyl]-1-N'-cyclopropylcyclopropane-1,1-dicarboxamide.
Molecular Properties
| Compound Name | 1-N'-[5-(2-aminoethylcarbamoyl)-2-pyridinyl]-1-N'-cyclopropylcyclopropane-1,1-dicarboxamide |
| PubChem CID | 67507894 |
| Molecular Formula | C16H21N5O3 |
| Molecular Weight | 331.38 g/mol |
| Exact Mass | 331.16 |
| IUPAC Name | 1-N'-[5-(2-aminoethylcarbamoyl)-2-pyridinyl]-1-N'-cyclopropylcyclopropane-1,1-dicarboxamide |
| SMILES | NCCNC(=O)c1ccc(N(C(=O)C2(C(N)=O)CC2)C2CC2)nc1 |
| InChI | InChI=1S/C16H21N5O3/c17-7-8-19-13(22)10-1-4-12(20-9-10)21(11-2-3-11)15(24)16(5-6-16)14(18)23/h1,4,9,11H,2-3,5-8,17H2,(H2,18,23)(H,19,22) |
| InChIKey | QBXZAKJUVNAMMC-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 131.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.38 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 1-N'-[5-(2-aminoethylcarbamoyl)-2-pyridinyl]-1-N'-cyclopropylcyclopropane-1,1-dicarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-N'-[5-(2-aminoethylcarbamoyl)-2-pyridinyl]-1-N'-cyclopropylcyclopropane-1,1-dicarboxamide?
The IUPAC name of 1-N'-[5-(2-aminoethylcarbamoyl)-2-pyridinyl]-1-N'-cyclopropylcyclopropane-1,1-dicarboxamide (CID 67507894) is 1-N'-[5-(2-aminoethylcarbamoyl)-2-pyridinyl]-1-N'-cyclopropylcyclopropane-1,1-dicarboxamide.
What is the SMILES notation for 1-N'-[5-(2-aminoethylcarbamoyl)-2-pyridinyl]-1-N'-cyclopropylcyclopropane-1,1-dicarboxamide?
The canonical SMILES for 1-N'-[5-(2-aminoethylcarbamoyl)-2-pyridinyl]-1-N'-cyclopropylcyclopropane-1,1-dicarboxamide is NCCNC(=O)c1ccc(N(C(=O)C2(C(N)=O)CC2)C2CC2)nc1.
What is the InChIKey of 1-N'-[5-(2-aminoethylcarbamoyl)-2-pyridinyl]-1-N'-cyclopropylcyclopropane-1,1-dicarboxamide?
The InChIKey is QBXZAKJUVNAMMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21N5O3/c17-7-8-19-13(22)10-1-4-12(20-9-10)21(11-2-3-11)15(24)16(5-6-16)14(18)23/h1,4,9,11H,2-3,5-8,17H2,(H2,18,23)(H,19,22).
What are the key properties of 1-N'-[5-(2-aminoethylcarbamoyl)-2-pyridinyl]-1-N'-cyclopropylcyclopropane-1,1-dicarboxamide?
1-N'-[5-(2-aminoethylcarbamoyl)-2-pyridinyl]-1-N'-cyclopropylcyclopropane-1,1-dicarboxamide has a molecular weight of 331.38 g/mol, XLogP of -0.47, 7 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-N'-[5-(2-aminoethylcarbamoyl)-2-pyridinyl]-1-N'-cyclopropylcyclopropane-1,1-dicarboxamide is sourced from PubChem (CID 67507894), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).