C16H10ClF3N2O3 — CID 67508616
2-[[5-chloro-6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]isoindole-1,3-dione (PubChem CID 67508616) has the molecular formula C16H10ClF3N2O3 and a molecular weight of 370.71 g/mol. Its IUPAC name is 2-[[5-chloro-6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]isoindole-1,3-dione.
| Compound Name | 2-[[5-chloro-6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 67508616 |
| Molecular Formula | C16H10ClF3N2O3 |
| Molecular Weight | 370.71 g/mol |
| Exact Mass | 370.03 |
| IUPAC Name | 2-[[5-chloro-6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1Cc1cnc(OCC(F)(F)F)c(Cl)c1 |
| InChI | InChI=1S/C16H10ClF3N2O3/c17-12-5-9(6-21-13(12)25-8-16(18,19)20)7-22-14(23)10-3-1-2-4-11(10)15(22)24/h1-6H,7-8H2 |
| InChIKey | WLWYNVJGTSGFOQ-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.71 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|