C17H21ClN4O2S — CID 67509209
5-chloro-4-(3-methyl-2-pyridinyl)-2-[4-(methylsulfonylmethyl)piperidin-1-yl]pyrimidine (PubChem CID 67509209) has the molecular formula C17H21ClN4O2S and a molecular weight of 380.90 g/mol. Its IUPAC name is 5-chloro-4-(3-methyl-2-pyridinyl)-2-[4-(methylsulfonylmethyl)piperidin-1-yl]pyrimidine.
| Compound Name | 5-chloro-4-(3-methyl-2-pyridinyl)-2-[4-(methylsulfonylmethyl)piperidin-1-yl]pyrimidine |
|---|---|
| PubChem CID | 67509209 |
| Molecular Formula | C17H21ClN4O2S |
| Molecular Weight | 380.90 g/mol |
| Exact Mass | 380.11 |
| IUPAC Name | 5-chloro-4-(3-methyl-2-pyridinyl)-2-[4-(methylsulfonylmethyl)piperidin-1-yl]pyrimidine |
| SMILES | Cc1cccnc1-c1nc(N2CCC(CS(C)(=O)=O)CC2)ncc1Cl |
| InChI | InChI=1S/C17H21ClN4O2S/c1-12-4-3-7-19-15(12)16-14(18)10-20-17(21-16)22-8-5-13(6-9-22)11-25(2,23)24/h3-4,7,10,13H,5-6,8-9,11H2,1-2H3 |
| InChIKey | CZYJPPYNWBXBIS-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 76.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.90 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |