About 2-methyl-N-[1-[6-(2,2,2-trifluoroethoxy)-2-pyridinyl]ethyl]propane-2-sulfinamide
2-methyl-N-[1-[6-(2,2,2-trifluoroethoxy)-2-pyridinyl]ethyl]propane-2-sulfinamide (PubChem CID 67509270) has the molecular formula C13H19F3N2O2S
and a molecular weight of 324.37 g/mol. Its IUPAC name is 2-methyl-N-[1-[6-(2,2,2-trifluoroethoxy)-2-pyridinyl]ethyl]propane-2-sulfinamide.
Molecular Properties
| Compound Name | 2-methyl-N-[1-[6-(2,2,2-trifluoroethoxy)-2-pyridinyl]ethyl]propane-2-sulfinamide |
| PubChem CID | 67509270 |
| Molecular Formula | C13H19F3N2O2S |
| Molecular Weight | 324.37 g/mol |
| Exact Mass | 324.11 |
| IUPAC Name | 2-methyl-N-[1-[6-(2,2,2-trifluoroethoxy)-2-pyridinyl]ethyl]propane-2-sulfinamide |
| SMILES | CC(NS(=O)C(C)(C)C)c1cccc(OCC(F)(F)F)n1 |
| InChI | InChI=1S/C13H19F3N2O2S/c1-9(18-21(19)12(2,3)4)10-6-5-7-11(17-10)20-8-13(14,15)16/h5-7,9,18H,8H2,1-4H3 |
| InChIKey | DUWXZTBVXJYWDQ-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.37 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-methyl-N-[1-[6-(2,2,2-trifluoroethoxy)-2-pyridinyl]ethyl]propane-2-sulfinamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-N-[1-[6-(2,2,2-trifluoroethoxy)-2-pyridinyl]ethyl]propane-2-sulfinamide?
The IUPAC name of 2-methyl-N-[1-[6-(2,2,2-trifluoroethoxy)-2-pyridinyl]ethyl]propane-2-sulfinamide (CID 67509270) is 2-methyl-N-[1-[6-(2,2,2-trifluoroethoxy)-2-pyridinyl]ethyl]propane-2-sulfinamide.
What is the SMILES notation for 2-methyl-N-[1-[6-(2,2,2-trifluoroethoxy)-2-pyridinyl]ethyl]propane-2-sulfinamide?
The canonical SMILES for 2-methyl-N-[1-[6-(2,2,2-trifluoroethoxy)-2-pyridinyl]ethyl]propane-2-sulfinamide is CC(NS(=O)C(C)(C)C)c1cccc(OCC(F)(F)F)n1.
What is the InChIKey of 2-methyl-N-[1-[6-(2,2,2-trifluoroethoxy)-2-pyridinyl]ethyl]propane-2-sulfinamide?
The InChIKey is DUWXZTBVXJYWDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19F3N2O2S/c1-9(18-21(19)12(2,3)4)10-6-5-7-11(17-10)20-8-13(14,15)16/h5-7,9,18H,8H2,1-4H3.
What are the key properties of 2-methyl-N-[1-[6-(2,2,2-trifluoroethoxy)-2-pyridinyl]ethyl]propane-2-sulfinamide?
2-methyl-N-[1-[6-(2,2,2-trifluoroethoxy)-2-pyridinyl]ethyl]propane-2-sulfinamide has a molecular weight of 324.37 g/mol, XLogP of 3.14, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-N-[1-[6-(2,2,2-trifluoroethoxy)-2-pyridinyl]ethyl]propane-2-sulfinamide is sourced from PubChem (CID 67509270), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).