About N-methyl-1-[5-methyl-6-(2,2,2-trifluoroethoxy)-3-pyridinyl]ethanamine;hydrochloride
N-methyl-1-[5-methyl-6-(2,2,2-trifluoroethoxy)-3-pyridinyl]ethanamine;hydrochloride (PubChem CID 67509330) has the molecular formula C11H16ClF3N2O
and a molecular weight of 284.71 g/mol. Its IUPAC name is N-methyl-1-[5-methyl-6-(2,2,2-trifluoroethoxy)-3-pyridinyl]ethanamine;hydrochloride.
Molecular Properties
| Compound Name | N-methyl-1-[5-methyl-6-(2,2,2-trifluoroethoxy)-3-pyridinyl]ethanamine;hydrochloride |
| PubChem CID | 67509330 |
| Molecular Formula | C11H16ClF3N2O |
| Molecular Weight | 284.71 g/mol |
| Exact Mass | 284.09 |
| IUPAC Name | N-methyl-1-[5-methyl-6-(2,2,2-trifluoroethoxy)-3-pyridinyl]ethanamine;hydrochloride |
| SMILES | CNC(C)c1cnc(OCC(F)(F)F)c(C)c1.Cl |
| InChI | InChI=1S/C11H15F3N2O.ClH/c1-7-4-9(8(2)15-3)5-16-10(7)17-6-11(12,13)14;/h4-5,8,15H,6H2,1-3H3;1H |
| InChIKey | DQQFHXNTQAMHKT-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.71 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-methyl-1-[5-methyl-6-(2,2,2-trifluoroethoxy)-3-pyridinyl]ethanamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-1-[5-methyl-6-(2,2,2-trifluoroethoxy)-3-pyridinyl]ethanamine;hydrochloride?
The IUPAC name of N-methyl-1-[5-methyl-6-(2,2,2-trifluoroethoxy)-3-pyridinyl]ethanamine;hydrochloride (CID 67509330) is N-methyl-1-[5-methyl-6-(2,2,2-trifluoroethoxy)-3-pyridinyl]ethanamine;hydrochloride.
What is the SMILES notation for N-methyl-1-[5-methyl-6-(2,2,2-trifluoroethoxy)-3-pyridinyl]ethanamine;hydrochloride?
The canonical SMILES for N-methyl-1-[5-methyl-6-(2,2,2-trifluoroethoxy)-3-pyridinyl]ethanamine;hydrochloride is CNC(C)c1cnc(OCC(F)(F)F)c(C)c1.Cl.
What is the InChIKey of N-methyl-1-[5-methyl-6-(2,2,2-trifluoroethoxy)-3-pyridinyl]ethanamine;hydrochloride?
The InChIKey is DQQFHXNTQAMHKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15F3N2O.ClH/c1-7-4-9(8(2)15-3)5-16-10(7)17-6-11(12,13)14;/h4-5,8,15H,6H2,1-3H3;1H.
What are the key properties of N-methyl-1-[5-methyl-6-(2,2,2-trifluoroethoxy)-3-pyridinyl]ethanamine;hydrochloride?
N-methyl-1-[5-methyl-6-(2,2,2-trifluoroethoxy)-3-pyridinyl]ethanamine;hydrochloride has a molecular weight of 284.71 g/mol, XLogP of 3.03, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-1-[5-methyl-6-(2,2,2-trifluoroethoxy)-3-pyridinyl]ethanamine;hydrochloride is sourced from PubChem (CID 67509330), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).