About [5-methoxy-6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methanamine
[5-methoxy-6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methanamine (PubChem CID 67509821) has the molecular formula C9H11F3N2O2
and a molecular weight of 236.19 g/mol. Its IUPAC name is [5-methoxy-6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methanamine.
Molecular Properties
| Compound Name | [5-methoxy-6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methanamine |
| PubChem CID | 67509821 |
| Molecular Formula | C9H11F3N2O2 |
| Molecular Weight | 236.19 g/mol |
| Exact Mass | 236.08 |
| IUPAC Name | [5-methoxy-6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methanamine |
| SMILES | COc1cc(CN)cnc1OCC(F)(F)F |
| InChI | InChI=1S/C9H11F3N2O2/c1-15-7-2-6(3-13)4-14-8(7)16-5-9(10,11)12/h2,4H,3,5,13H2,1H3 |
| InChIKey | HOBFZKQRXVVRPM-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 57.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.19 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [5-methoxy-6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-methoxy-6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methanamine?
The IUPAC name of [5-methoxy-6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methanamine (CID 67509821) is [5-methoxy-6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methanamine.
What is the SMILES notation for [5-methoxy-6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methanamine?
The canonical SMILES for [5-methoxy-6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methanamine is COc1cc(CN)cnc1OCC(F)(F)F.
What is the InChIKey of [5-methoxy-6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methanamine?
The InChIKey is HOBFZKQRXVVRPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11F3N2O2/c1-15-7-2-6(3-13)4-14-8(7)16-5-9(10,11)12/h2,4H,3,5,13H2,1H3.
What are the key properties of [5-methoxy-6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methanamine?
[5-methoxy-6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methanamine has a molecular weight of 236.19 g/mol, XLogP of 1.49, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [5-methoxy-6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methanamine is sourced from PubChem (CID 67509821), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).