C19H17FN2O — CID 67509946
3-[2-(3-fluorophenyl)ethynyl]-8,8-dimethyl-7,9-dihydro-6H-pyrido[3,2-c]azepin-5-one (PubChem CID 67509946) has the molecular formula C19H17FN2O and a molecular weight of 308.36 g/mol. Its IUPAC name is 3-[2-(3-fluorophenyl)ethynyl]-8,8-dimethyl-7,9-dihydro-6H-pyrido[3,2-c]azepin-5-one.
| Compound Name | 3-[2-(3-fluorophenyl)ethynyl]-8,8-dimethyl-7,9-dihydro-6H-pyrido[3,2-c]azepin-5-one |
|---|---|
| PubChem CID | 67509946 |
| Molecular Formula | C19H17FN2O |
| Molecular Weight | 308.36 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | 3-[2-(3-fluorophenyl)ethynyl]-8,8-dimethyl-7,9-dihydro-6H-pyrido[3,2-c]azepin-5-one |
| SMILES | CC1(C)CNC(=O)c2cc(C#Cc3cccc(F)c3)cnc2C1 |
| InChI | InChI=1S/C19H17FN2O/c1-19(2)10-17-16(18(23)22-12-19)9-14(11-21-17)7-6-13-4-3-5-15(20)8-13/h3-5,8-9,11H,10,12H2,1-2H3,(H,22,23) |
| InChIKey | CBCNDSANPUJPPP-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.36 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|