C26H21N3S2 — CID 67510404
3-[2,4-bis(5-methylthiophen-2-yl)imidazol-1-yl]-9-methylcarbazole (PubChem CID 67510404) has the molecular formula C26H21N3S2 and a molecular weight of 439.61 g/mol. Its IUPAC name is 3-[2,4-bis(5-methylthiophen-2-yl)imidazol-1-yl]-9-methylcarbazole.
| Compound Name | 3-[2,4-bis(5-methylthiophen-2-yl)imidazol-1-yl]-9-methylcarbazole |
|---|---|
| PubChem CID | 67510404 |
| Molecular Formula | C26H21N3S2 |
| Molecular Weight | 439.61 g/mol |
| Exact Mass | 439.12 |
| IUPAC Name | 3-[2,4-bis(5-methylthiophen-2-yl)imidazol-1-yl]-9-methylcarbazole |
| SMILES | Cc1ccc(-c2cn(-c3ccc4c(c3)c3ccccc3n4C)c(-c3ccc(C)s3)n2)s1 |
| InChI | InChI=1S/C26H21N3S2/c1-16-8-12-24(30-16)21-15-29(26(27-21)25-13-9-17(2)31-25)18-10-11-23-20(14-18)19-6-4-5-7-22(19)28(23)3/h4-15H,1-3H3 |
| InChIKey | NCMXWGOKYUYACT-UHFFFAOYSA-N |
| XLogP | 7.59 |
| TPSA | 22.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.61 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |