About 7-methyl-3-(2-phenylethynyl)-7,8-dihydroquinoline
7-methyl-3-(2-phenylethynyl)-7,8-dihydroquinoline (PubChem CID 67510745) has the molecular formula C18H15N
and a molecular weight of 245.32 g/mol. Its IUPAC name is 7-methyl-3-(2-phenylethynyl)-7,8-dihydroquinoline.
Molecular Properties
| Compound Name | 7-methyl-3-(2-phenylethynyl)-7,8-dihydroquinoline |
| PubChem CID | 67510745 |
| Molecular Formula | C18H15N |
| Molecular Weight | 245.32 g/mol |
| Exact Mass | 245.12 |
| IUPAC Name | 7-methyl-3-(2-phenylethynyl)-7,8-dihydroquinoline |
| SMILES | CC1C=Cc2cc(C#Cc3ccccc3)cnc2C1 |
| InChI | InChI=1S/C18H15N/c1-14-7-10-17-12-16(13-19-18(17)11-14)9-8-15-5-3-2-4-6-15/h2-7,10,12-14H,11H2,1H3 |
| InChIKey | IUDXVVLNFOXBSL-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.32 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 7-methyl-3-(2-phenylethynyl)-7,8-dihydroquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methyl-3-(2-phenylethynyl)-7,8-dihydroquinoline?
The IUPAC name of 7-methyl-3-(2-phenylethynyl)-7,8-dihydroquinoline (CID 67510745) is 7-methyl-3-(2-phenylethynyl)-7,8-dihydroquinoline.
What is the SMILES notation for 7-methyl-3-(2-phenylethynyl)-7,8-dihydroquinoline?
The canonical SMILES for 7-methyl-3-(2-phenylethynyl)-7,8-dihydroquinoline is CC1C=Cc2cc(C#Cc3ccccc3)cnc2C1.
What is the InChIKey of 7-methyl-3-(2-phenylethynyl)-7,8-dihydroquinoline?
The InChIKey is IUDXVVLNFOXBSL-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15N/c1-14-7-10-17-12-16(13-19-18(17)11-14)9-8-15-5-3-2-4-6-15/h2-7,10,12-14H,11H2,1H3.
What are the key properties of 7-methyl-3-(2-phenylethynyl)-7,8-dihydroquinoline?
7-methyl-3-(2-phenylethynyl)-7,8-dihydroquinoline has a molecular weight of 245.32 g/mol, XLogP of 3.69, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methyl-3-(2-phenylethynyl)-7,8-dihydroquinoline is sourced from PubChem (CID 67510745), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).