About 3-amino-5,5-dimethylcyclohex-2-en-1-one;hydrobromide
3-amino-5,5-dimethylcyclohex-2-en-1-one;hydrobromide (PubChem CID 67510926) has the molecular formula C8H14BrNO
and a molecular weight of 220.11 g/mol. Its IUPAC name is 3-amino-5,5-dimethylcyclohex-2-en-1-one;hydrobromide.
Molecular Properties
| Compound Name | 3-amino-5,5-dimethylcyclohex-2-en-1-one;hydrobromide |
| PubChem CID | 67510926 |
| Molecular Formula | C8H14BrNO |
| Molecular Weight | 220.11 g/mol |
| Exact Mass | 219.03 |
| IUPAC Name | 3-amino-5,5-dimethylcyclohex-2-en-1-one;hydrobromide |
| SMILES | Br.CC1(C)CC(=O)C=C(N)C1 |
| InChI | InChI=1S/C8H13NO.BrH/c1-8(2)4-6(9)3-7(10)5-8;/h3H,4-5,9H2,1-2H3;1H |
| InChIKey | DWDNMWIYAODIDO-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.11 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-amino-5,5-dimethylcyclohex-2-en-1-one;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-5,5-dimethylcyclohex-2-en-1-one;hydrobromide?
The IUPAC name of 3-amino-5,5-dimethylcyclohex-2-en-1-one;hydrobromide (CID 67510926) is 3-amino-5,5-dimethylcyclohex-2-en-1-one;hydrobromide.
What is the SMILES notation for 3-amino-5,5-dimethylcyclohex-2-en-1-one;hydrobromide?
The canonical SMILES for 3-amino-5,5-dimethylcyclohex-2-en-1-one;hydrobromide is Br.CC1(C)CC(=O)C=C(N)C1.
What is the InChIKey of 3-amino-5,5-dimethylcyclohex-2-en-1-one;hydrobromide?
The InChIKey is DWDNMWIYAODIDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13NO.BrH/c1-8(2)4-6(9)3-7(10)5-8;/h3H,4-5,9H2,1-2H3;1H.
What are the key properties of 3-amino-5,5-dimethylcyclohex-2-en-1-one;hydrobromide?
3-amino-5,5-dimethylcyclohex-2-en-1-one;hydrobromide has a molecular weight of 220.11 g/mol, XLogP of 1.80, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-5,5-dimethylcyclohex-2-en-1-one;hydrobromide is sourced from PubChem (CID 67510926), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).