About dimethyl 2-[(7R)-1,4-dioxaspiro[4.5]decan-7-yl]propanedioate
dimethyl 2-[(7R)-1,4-dioxaspiro[4.5]decan-7-yl]propanedioate (PubChem CID 67511086) has the molecular formula C13H20O6
and a molecular weight of 272.30 g/mol. Its IUPAC name is dimethyl 2-[(7R)-1,4-dioxaspiro[4.5]decan-7-yl]propanedioate.
Molecular Properties
| Compound Name | dimethyl 2-[(7R)-1,4-dioxaspiro[4.5]decan-7-yl]propanedioate |
| PubChem CID | 67511086 |
| Molecular Formula | C13H20O6 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | dimethyl 2-[(7R)-1,4-dioxaspiro[4.5]decan-7-yl]propanedioate |
| SMILES | COC(=O)C(C(=O)OC)[C@@H]1CCCC2(C1)OCCO2 |
| InChI | InChI=1S/C13H20O6/c1-16-11(14)10(12(15)17-2)9-4-3-5-13(8-9)18-6-7-19-13/h9-10H,3-8H2,1-2H3/t9-/m1/s1 |
| InChIKey | CHGJOCTYTLQAEU-SECBINFHSA-N |
| XLogP | 0.88 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze dimethyl 2-[(7R)-1,4-dioxaspiro[4.5]decan-7-yl]propanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl 2-[(7R)-1,4-dioxaspiro[4.5]decan-7-yl]propanedioate?
The IUPAC name of dimethyl 2-[(7R)-1,4-dioxaspiro[4.5]decan-7-yl]propanedioate (CID 67511086) is dimethyl 2-[(7R)-1,4-dioxaspiro[4.5]decan-7-yl]propanedioate.
What is the SMILES notation for dimethyl 2-[(7R)-1,4-dioxaspiro[4.5]decan-7-yl]propanedioate?
The canonical SMILES for dimethyl 2-[(7R)-1,4-dioxaspiro[4.5]decan-7-yl]propanedioate is COC(=O)C(C(=O)OC)[C@@H]1CCCC2(C1)OCCO2.
What is the InChIKey of dimethyl 2-[(7R)-1,4-dioxaspiro[4.5]decan-7-yl]propanedioate?
The InChIKey is CHGJOCTYTLQAEU-SECBINFHSA-N. The full InChI is InChI=1S/C13H20O6/c1-16-11(14)10(12(15)17-2)9-4-3-5-13(8-9)18-6-7-19-13/h9-10H,3-8H2,1-2H3/t9-/m1/s1.
What are the key properties of dimethyl 2-[(7R)-1,4-dioxaspiro[4.5]decan-7-yl]propanedioate?
dimethyl 2-[(7R)-1,4-dioxaspiro[4.5]decan-7-yl]propanedioate has a molecular weight of 272.30 g/mol, XLogP of 0.88, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl 2-[(7R)-1,4-dioxaspiro[4.5]decan-7-yl]propanedioate is sourced from PubChem (CID 67511086), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).