C33H26F5N5O7 — CID 67511300
[5-[[3-[8-(2,6-difluorophenyl)-2-(1,3-dihydroxypropan-2-ylamino)-7-oxopyrido[2,3-d]pyrimidin-4-yl]-4-methylphenyl]carbamoyl]-3-hydroxy-2-methylphenyl] 2,2,2-trifluoroacetate (PubChem CID 67511300) has the molecular formula C33H26F5N5O7 and a molecular weight of 699.59 g/mol. Its IUPAC name is [5-[[3-[8-(2,6-difluorophenyl)-2-(1,3-dihydroxypropan-2-ylamino)-7-oxopyrido[2,3-d]pyrimidin-4-yl]-4-methylphenyl]carbamoyl]-3-hydroxy-2-methylphenyl] 2,2,2-trifluoroacetate.
| Compound Name | [5-[[3-[8-(2,6-difluorophenyl)-2-(1,3-dihydroxypropan-2-ylamino)-7-oxopyrido[2,3-d]pyrimidin-4-yl]-4-methylphenyl]carbamoyl]-3-hydroxy-2-methylphenyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 67511300 |
| Molecular Formula | C33H26F5N5O7 |
| Molecular Weight | 699.59 g/mol |
| Exact Mass | 699.18 |
| IUPAC Name | [5-[[3-[8-(2,6-difluorophenyl)-2-(1,3-dihydroxypropan-2-ylamino)-7-oxopyrido[2,3-d]pyrimidin-4-yl]-4-methylphenyl]carbamoyl]-3-hydroxy-2-methylphenyl] 2,2,2-trifluoroacetate |
| SMILES | Cc1ccc(NC(=O)c2cc(O)c(C)c(OC(=O)C(F)(F)F)c2)cc1-c1nc(NC(CO)CO)nc2c1ccc(=O)n2-c1c(F)cccc1F |
| InChI | InChI=1S/C33H26F5N5O7/c1-15-6-7-18(39-30(48)17-10-24(46)16(2)25(11-17)50-31(49)33(36,37)38)12-21(15)27-20-8-9-26(47)43(28-22(34)4-3-5-23(28)35)29(20)42-32(41-27)40-19(13-44)14-45/h3-12,19,44-46H,13-14H2,1-2H3,(H,39,48)(H,40,41,42) |
| InChIKey | RRVLMRQWQQPFOL-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 175.90 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.59 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|