About 3-(9-methylpyrido[3,4-b]indol-6-yl)benzenesulfonamide
3-(9-methylpyrido[3,4-b]indol-6-yl)benzenesulfonamide (PubChem CID 67511321) has the molecular formula C18H15N3O2S
and a molecular weight of 337.40 g/mol. Its IUPAC name is 3-(9-methylpyrido[3,4-b]indol-6-yl)benzenesulfonamide.
Molecular Properties
| Compound Name | 3-(9-methylpyrido[3,4-b]indol-6-yl)benzenesulfonamide |
| PubChem CID | 67511321 |
| Molecular Formula | C18H15N3O2S |
| Molecular Weight | 337.40 g/mol |
| Exact Mass | 337.09 |
| IUPAC Name | 3-(9-methylpyrido[3,4-b]indol-6-yl)benzenesulfonamide |
| SMILES | Cn1c2ccc(-c3cccc(S(N)(=O)=O)c3)cc2c2ccncc21 |
| InChI | InChI=1S/C18H15N3O2S/c1-21-17-6-5-13(10-16(17)15-7-8-20-11-18(15)21)12-3-2-4-14(9-12)24(19,22)23/h2-11H,1H3,(H2,19,22,23) |
| InChIKey | UVZONPIQMNROSQ-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 77.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.40 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(9-methylpyrido[3,4-b]indol-6-yl)benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(9-methylpyrido[3,4-b]indol-6-yl)benzenesulfonamide?
The IUPAC name of 3-(9-methylpyrido[3,4-b]indol-6-yl)benzenesulfonamide (CID 67511321) is 3-(9-methylpyrido[3,4-b]indol-6-yl)benzenesulfonamide.
What is the SMILES notation for 3-(9-methylpyrido[3,4-b]indol-6-yl)benzenesulfonamide?
The canonical SMILES for 3-(9-methylpyrido[3,4-b]indol-6-yl)benzenesulfonamide is Cn1c2ccc(-c3cccc(S(N)(=O)=O)c3)cc2c2ccncc21.
What is the InChIKey of 3-(9-methylpyrido[3,4-b]indol-6-yl)benzenesulfonamide?
The InChIKey is UVZONPIQMNROSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15N3O2S/c1-21-17-6-5-13(10-16(17)15-7-8-20-11-18(15)21)12-3-2-4-14(9-12)24(19,22)23/h2-11H,1H3,(H2,19,22,23).
What are the key properties of 3-(9-methylpyrido[3,4-b]indol-6-yl)benzenesulfonamide?
3-(9-methylpyrido[3,4-b]indol-6-yl)benzenesulfonamide has a molecular weight of 337.40 g/mol, XLogP of 3.04, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(9-methylpyrido[3,4-b]indol-6-yl)benzenesulfonamide is sourced from PubChem (CID 67511321), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).