C34H28F5N5O5 — CID 67511610
[2-[[8-(2,6-difluorophenyl)-4-[2-methyl-5-[[2-(3-methylphenyl)acetyl]amino]phenyl]-7-oxopyrido[2,3-d]pyrimidin-2-yl]amino]-3-hydroxypropyl] 2,2,2-trifluoroacetate (PubChem CID 67511610) has the molecular formula C34H28F5N5O5 and a molecular weight of 681.62 g/mol. Its IUPAC name is [2-[[8-(2,6-difluorophenyl)-4-[2-methyl-5-[[2-(3-methylphenyl)acetyl]amino]phenyl]-7-oxopyrido[2,3-d]pyrimidin-2-yl]amino]-3-hydroxypropyl] 2,2,2-trifluoroacetate.
| Compound Name | [2-[[8-(2,6-difluorophenyl)-4-[2-methyl-5-[[2-(3-methylphenyl)acetyl]amino]phenyl]-7-oxopyrido[2,3-d]pyrimidin-2-yl]amino]-3-hydroxypropyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 67511610 |
| Molecular Formula | C34H28F5N5O5 |
| Molecular Weight | 681.62 g/mol |
| Exact Mass | 681.20 |
| IUPAC Name | [2-[[8-(2,6-difluorophenyl)-4-[2-methyl-5-[[2-(3-methylphenyl)acetyl]amino]phenyl]-7-oxopyrido[2,3-d]pyrimidin-2-yl]amino]-3-hydroxypropyl] 2,2,2-trifluoroacetate |
| SMILES | Cc1cccc(CC(=O)Nc2ccc(C)c(-c3nc(NC(CO)COC(=O)C(F)(F)F)nc4c3ccc(=O)n4-c3c(F)cccc3F)c2)c1 |
| InChI | InChI=1S/C34H28F5N5O5/c1-18-5-3-6-20(13-18)14-27(46)40-21-10-9-19(2)24(15-21)29-23-11-12-28(47)44(30-25(35)7-4-8-26(30)36)31(23)43-33(42-29)41-22(16-45)17-49-32(48)34(37,38)39/h3-13,15,22,45H,14,16-17H2,1-2H3,(H,40,46)(H,41,42,43) |
| InChIKey | CKCUACCWIDOMMI-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 135.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.62 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |