About 2-(4-methylphenoxy)-N-(1,3-thiazol-2-yl)-N-(thiophen-2-ylmethyl)acetamide
2-(4-methylphenoxy)-N-(1,3-thiazol-2-yl)-N-(thiophen-2-ylmethyl)acetamide (PubChem CID 67511668) has the molecular formula C17H16N2O2S2
and a molecular weight of 344.46 g/mol. Its IUPAC name is 2-(4-methylphenoxy)-N-(1,3-thiazol-2-yl)-N-(thiophen-2-ylmethyl)acetamide.
Molecular Properties
| Compound Name | 2-(4-methylphenoxy)-N-(1,3-thiazol-2-yl)-N-(thiophen-2-ylmethyl)acetamide |
| PubChem CID | 67511668 |
| Molecular Formula | C17H16N2O2S2 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.07 |
| IUPAC Name | 2-(4-methylphenoxy)-N-(1,3-thiazol-2-yl)-N-(thiophen-2-ylmethyl)acetamide |
| SMILES | Cc1ccc(OCC(=O)N(Cc2cccs2)c2nccs2)cc1 |
| InChI | InChI=1S/C17H16N2O2S2/c1-13-4-6-14(7-5-13)21-12-16(20)19(17-18-8-10-23-17)11-15-3-2-9-22-15/h2-10H,11-12H2,1H3 |
| InChIKey | ZPRCVRCDINKUGZ-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(4-methylphenoxy)-N-(1,3-thiazol-2-yl)-N-(thiophen-2-ylmethyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-methylphenoxy)-N-(1,3-thiazol-2-yl)-N-(thiophen-2-ylmethyl)acetamide?
The IUPAC name of 2-(4-methylphenoxy)-N-(1,3-thiazol-2-yl)-N-(thiophen-2-ylmethyl)acetamide (CID 67511668) is 2-(4-methylphenoxy)-N-(1,3-thiazol-2-yl)-N-(thiophen-2-ylmethyl)acetamide.
What is the SMILES notation for 2-(4-methylphenoxy)-N-(1,3-thiazol-2-yl)-N-(thiophen-2-ylmethyl)acetamide?
The canonical SMILES for 2-(4-methylphenoxy)-N-(1,3-thiazol-2-yl)-N-(thiophen-2-ylmethyl)acetamide is Cc1ccc(OCC(=O)N(Cc2cccs2)c2nccs2)cc1.
What is the InChIKey of 2-(4-methylphenoxy)-N-(1,3-thiazol-2-yl)-N-(thiophen-2-ylmethyl)acetamide?
The InChIKey is ZPRCVRCDINKUGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16N2O2S2/c1-13-4-6-14(7-5-13)21-12-16(20)19(17-18-8-10-23-17)11-15-3-2-9-22-15/h2-10H,11-12H2,1H3.
What are the key properties of 2-(4-methylphenoxy)-N-(1,3-thiazol-2-yl)-N-(thiophen-2-ylmethyl)acetamide?
2-(4-methylphenoxy)-N-(1,3-thiazol-2-yl)-N-(thiophen-2-ylmethyl)acetamide has a molecular weight of 344.46 g/mol, XLogP of 4.13, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-methylphenoxy)-N-(1,3-thiazol-2-yl)-N-(thiophen-2-ylmethyl)acetamide is sourced from PubChem (CID 67511668), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).