About 3-(9-ethylpyrido[3,4-b]indol-6-yl)benzamide
3-(9-ethylpyrido[3,4-b]indol-6-yl)benzamide (PubChem CID 67511923) has the molecular formula C20H17N3O
and a molecular weight of 315.38 g/mol. Its IUPAC name is 3-(9-ethylpyrido[3,4-b]indol-6-yl)benzamide.
Molecular Properties
| Compound Name | 3-(9-ethylpyrido[3,4-b]indol-6-yl)benzamide |
| PubChem CID | 67511923 |
| Molecular Formula | C20H17N3O |
| Molecular Weight | 315.38 g/mol |
| Exact Mass | 315.14 |
| IUPAC Name | 3-(9-ethylpyrido[3,4-b]indol-6-yl)benzamide |
| SMILES | CCn1c2ccc(-c3cccc(C(N)=O)c3)cc2c2ccncc21 |
| InChI | InChI=1S/C20H17N3O/c1-2-23-18-7-6-14(13-4-3-5-15(10-13)20(21)24)11-17(18)16-8-9-22-12-19(16)23/h3-12H,2H2,1H3,(H2,21,24) |
| InChIKey | MKMDZVRLPCCMPR-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 60.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.38 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(9-ethylpyrido[3,4-b]indol-6-yl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(9-ethylpyrido[3,4-b]indol-6-yl)benzamide?
The IUPAC name of 3-(9-ethylpyrido[3,4-b]indol-6-yl)benzamide (CID 67511923) is 3-(9-ethylpyrido[3,4-b]indol-6-yl)benzamide.
What is the SMILES notation for 3-(9-ethylpyrido[3,4-b]indol-6-yl)benzamide?
The canonical SMILES for 3-(9-ethylpyrido[3,4-b]indol-6-yl)benzamide is CCn1c2ccc(-c3cccc(C(N)=O)c3)cc2c2ccncc21.
What is the InChIKey of 3-(9-ethylpyrido[3,4-b]indol-6-yl)benzamide?
The InChIKey is MKMDZVRLPCCMPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H17N3O/c1-2-23-18-7-6-14(13-4-3-5-15(10-13)20(21)24)11-17(18)16-8-9-22-12-19(16)23/h3-12H,2H2,1H3,(H2,21,24).
What are the key properties of 3-(9-ethylpyrido[3,4-b]indol-6-yl)benzamide?
3-(9-ethylpyrido[3,4-b]indol-6-yl)benzamide has a molecular weight of 315.38 g/mol, XLogP of 3.98, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(9-ethylpyrido[3,4-b]indol-6-yl)benzamide is sourced from PubChem (CID 67511923), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).