C20H29F2N7O2 — CID 67512117
2-[4-[4-[2-tert-butyl-6-(difluoromethyl)pyrimidin-4-yl]piperazin-1-yl]butyl]-1,2,4-triazine-3,5-dione (PubChem CID 67512117) has the molecular formula C20H29F2N7O2 and a molecular weight of 437.50 g/mol. Its IUPAC name is 2-[4-[4-[2-tert-butyl-6-(difluoromethyl)pyrimidin-4-yl]piperazin-1-yl]butyl]-1,2,4-triazine-3,5-dione.
| Compound Name | 2-[4-[4-[2-tert-butyl-6-(difluoromethyl)pyrimidin-4-yl]piperazin-1-yl]butyl]-1,2,4-triazine-3,5-dione |
|---|---|
| PubChem CID | 67512117 |
| Molecular Formula | C20H29F2N7O2 |
| Molecular Weight | 437.50 g/mol |
| Exact Mass | 437.24 |
| IUPAC Name | 2-[4-[4-[2-tert-butyl-6-(difluoromethyl)pyrimidin-4-yl]piperazin-1-yl]butyl]-1,2,4-triazine-3,5-dione |
| SMILES | CC(C)(C)c1nc(C(F)F)cc(N2CCN(CCCCn3ncc(=O)[nH]c3=O)CC2)n1 |
| InChI | InChI=1S/C20H29F2N7O2/c1-20(2,3)18-24-14(17(21)22)12-15(25-18)28-10-8-27(9-11-28)6-4-5-7-29-19(31)26-16(30)13-23-29/h12-13,17H,4-11H2,1-3H3,(H,26,30,31) |
| InChIKey | QICWDZXYSQNKLO-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 100.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.50 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|