C19H21F3O2 — CID 67512411
(8R,9S,13S,14S)-13-methyl-3-(trifluoromethoxy)-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one (PubChem CID 67512411) has the molecular formula C19H21F3O2 and a molecular weight of 338.37 g/mol. Its IUPAC name is (8R,9S,13S,14S)-13-methyl-3-(trifluoromethoxy)-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one.
| Compound Name | (8R,9S,13S,14S)-13-methyl-3-(trifluoromethoxy)-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 67512411 |
| Molecular Formula | C19H21F3O2 |
| Molecular Weight | 338.37 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | (8R,9S,13S,14S)-13-methyl-3-(trifluoromethoxy)-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one |
| SMILES | C[C@]12CC[C@@H]3c4ccc(OC(F)(F)F)cc4CC[C@H]3[C@@H]1CCC2=O |
| InChI | InChI=1S/C19H21F3O2/c1-18-9-8-14-13-5-3-12(24-19(20,21)22)10-11(13)2-4-15(14)16(18)6-7-17(18)23/h3,5,10,14-16H,2,4,6-9H2,1H3/t14-,15-,16+,18+/m1/s1 |
| InChIKey | ZYRRJEUYCHGAAI-CBZIJGRNSA-N |
| XLogP | 5.01 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.37 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |