About 2,2-difluoro-N,N-dimethyl-2-(3-sulfamoylpyrazol-1-yl)acetamide
2,2-difluoro-N,N-dimethyl-2-(3-sulfamoylpyrazol-1-yl)acetamide (PubChem CID 67512417) has the molecular formula C7H10F2N4O3S
and a molecular weight of 268.25 g/mol. Its IUPAC name is 2,2-difluoro-N,N-dimethyl-2-(3-sulfamoylpyrazol-1-yl)acetamide.
Molecular Properties
| Compound Name | 2,2-difluoro-N,N-dimethyl-2-(3-sulfamoylpyrazol-1-yl)acetamide |
| PubChem CID | 67512417 |
| Molecular Formula | C7H10F2N4O3S |
| Molecular Weight | 268.25 g/mol |
| Exact Mass | 268.04 |
| IUPAC Name | 2,2-difluoro-N,N-dimethyl-2-(3-sulfamoylpyrazol-1-yl)acetamide |
| SMILES | CN(C)C(=O)C(F)(F)n1ccc(S(N)(=O)=O)n1 |
| InChI | InChI=1S/C7H10F2N4O3S/c1-12(2)6(14)7(8,9)13-4-3-5(11-13)17(10,15)16/h3-4H,1-2H3,(H2,10,15,16) |
| InChIKey | QJOWPAVHQZAZII-UHFFFAOYSA-N |
| XLogP | -0.83 |
| TPSA | 98.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.25 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2,2-difluoro-N,N-dimethyl-2-(3-sulfamoylpyrazol-1-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-difluoro-N,N-dimethyl-2-(3-sulfamoylpyrazol-1-yl)acetamide?
The IUPAC name of 2,2-difluoro-N,N-dimethyl-2-(3-sulfamoylpyrazol-1-yl)acetamide (CID 67512417) is 2,2-difluoro-N,N-dimethyl-2-(3-sulfamoylpyrazol-1-yl)acetamide.
What is the SMILES notation for 2,2-difluoro-N,N-dimethyl-2-(3-sulfamoylpyrazol-1-yl)acetamide?
The canonical SMILES for 2,2-difluoro-N,N-dimethyl-2-(3-sulfamoylpyrazol-1-yl)acetamide is CN(C)C(=O)C(F)(F)n1ccc(S(N)(=O)=O)n1.
What is the InChIKey of 2,2-difluoro-N,N-dimethyl-2-(3-sulfamoylpyrazol-1-yl)acetamide?
The InChIKey is QJOWPAVHQZAZII-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10F2N4O3S/c1-12(2)6(14)7(8,9)13-4-3-5(11-13)17(10,15)16/h3-4H,1-2H3,(H2,10,15,16).
What are the key properties of 2,2-difluoro-N,N-dimethyl-2-(3-sulfamoylpyrazol-1-yl)acetamide?
2,2-difluoro-N,N-dimethyl-2-(3-sulfamoylpyrazol-1-yl)acetamide has a molecular weight of 268.25 g/mol, XLogP of -0.83, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-difluoro-N,N-dimethyl-2-(3-sulfamoylpyrazol-1-yl)acetamide is sourced from PubChem (CID 67512417), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).