C14H19NO — CID 67512881
4,4a,5,6,6a,7,8,12a-octahydro-1H-pyrido[1,2-b][2]benzazepin-12-one (PubChem CID 67512881) has the molecular formula C14H19NO and a molecular weight of 217.31 g/mol. Its IUPAC name is 4,4a,5,6,6a,7,8,12a-octahydro-1H-pyrido[1,2-b][2]benzazepin-12-one.
| Compound Name | 4,4a,5,6,6a,7,8,12a-octahydro-1H-pyrido[1,2-b][2]benzazepin-12-one |
|---|---|
| PubChem CID | 67512881 |
| Molecular Formula | C14H19NO |
| Molecular Weight | 217.31 g/mol |
| Exact Mass | 217.15 |
| IUPAC Name | 4,4a,5,6,6a,7,8,12a-octahydro-1H-pyrido[1,2-b][2]benzazepin-12-one |
| SMILES | O=C1C2CC=CCC2CCC2CCC=CN12 |
| InChI | InChI=1S/C14H19NO/c16-14-13-7-2-1-5-11(13)8-9-12-6-3-4-10-15(12)14/h1-2,4,10-13H,3,5-9H2 |
| InChIKey | IKSUXVHBOKYZQS-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.31 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|