C36H51N5O4SSi2 — CID 67513578
5-(1,1-dioxothian-4-yl)-6-ethenyl-3-(6-phenyl-3-pyridinyl)-N,N-bis(2-trimethylsilylethoxymethyl)pyrazolo[1,5-a]pyrimidin-7-amine (PubChem CID 67513578) has the molecular formula C36H51N5O4SSi2 and a molecular weight of 706.07 g/mol. Its IUPAC name is 5-(1,1-dioxothian-4-yl)-6-ethenyl-3-(6-phenyl-3-pyridinyl)-N,N-bis(2-trimethylsilylethoxymethyl)pyrazolo[1,5-a]pyrimidin-7-amine.
| Compound Name | 5-(1,1-dioxothian-4-yl)-6-ethenyl-3-(6-phenyl-3-pyridinyl)-N,N-bis(2-trimethylsilylethoxymethyl)pyrazolo[1,5-a]pyrimidin-7-amine |
|---|---|
| PubChem CID | 67513578 |
| Molecular Formula | C36H51N5O4SSi2 |
| Molecular Weight | 706.07 g/mol |
| Exact Mass | 705.32 |
| IUPAC Name | 5-(1,1-dioxothian-4-yl)-6-ethenyl-3-(6-phenyl-3-pyridinyl)-N,N-bis(2-trimethylsilylethoxymethyl)pyrazolo[1,5-a]pyrimidin-7-amine |
| SMILES | C=Cc1c(C2CCS(=O)(=O)CC2)nc2c(-c3ccc(-c4ccccc4)nc3)cnn2c1N(COCC[Si](C)(C)C)COCC[Si](C)(C)C |
| InChI | InChI=1S/C36H51N5O4SSi2/c1-8-31-34(29-16-20-46(42,43)21-17-29)39-35-32(30-14-15-33(37-24-30)28-12-10-9-11-13-28)25-38-41(35)36(31)40(26-44-18-22-47(2,3)4)27-45-19-23-48(5,6)7/h8-15,24-25,29H,1,16-23,26-27H2,2-7H3 |
| InChIKey | CPHXZEGQBXDPGY-UHFFFAOYSA-N |
| XLogP | 7.82 |
| TPSA | 98.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.07 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|