C25H29BN4O4S — CID 67513706
1-(benzenesulfonyl)-5-(1-propan-2-ylpyrazol-4-yl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolo[2,3-b]pyridine (PubChem CID 67513706) has the molecular formula C25H29BN4O4S and a molecular weight of 492.41 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-5-(1-propan-2-ylpyrazol-4-yl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolo[2,3-b]pyridine.
| Compound Name | 1-(benzenesulfonyl)-5-(1-propan-2-ylpyrazol-4-yl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 67513706 |
| Molecular Formula | C25H29BN4O4S |
| Molecular Weight | 492.41 g/mol |
| Exact Mass | 492.20 |
| IUPAC Name | 1-(benzenesulfonyl)-5-(1-propan-2-ylpyrazol-4-yl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolo[2,3-b]pyridine |
| SMILES | CC(C)n1cc(-c2cnc3c(c2)c(B2OC(C)(C)C(C)(C)O2)cn3S(=O)(=O)c2ccccc2)cn1 |
| InChI | InChI=1S/C25H29BN4O4S/c1-17(2)29-15-19(14-28-29)18-12-21-22(26-33-24(3,4)25(5,6)34-26)16-30(23(21)27-13-18)35(31,32)20-10-8-7-9-11-20/h7-17H,1-6H3 |
| InChIKey | DVLTZVWMNWAXSR-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 88.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.41 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|