C37H54FN5O4Si2 — CID 67513796
ethyl 4-[7-[bis(2-trimethylsilylethoxymethyl)amino]-3-(6-fluoroquinolin-3-yl)pyrazolo[1,5-a]pyrimidin-5-yl]-1-methylcyclohexane-1-carboxylate (PubChem CID 67513796) has the molecular formula C37H54FN5O4Si2 and a molecular weight of 708.04 g/mol. Its IUPAC name is ethyl 4-[7-[bis(2-trimethylsilylethoxymethyl)amino]-3-(6-fluoroquinolin-3-yl)pyrazolo[1,5-a]pyrimidin-5-yl]-1-methylcyclohexane-1-carboxylate.
| Compound Name | ethyl 4-[7-[bis(2-trimethylsilylethoxymethyl)amino]-3-(6-fluoroquinolin-3-yl)pyrazolo[1,5-a]pyrimidin-5-yl]-1-methylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 67513796 |
| Molecular Formula | C37H54FN5O4Si2 |
| Molecular Weight | 708.04 g/mol |
| Exact Mass | 707.37 |
| IUPAC Name | ethyl 4-[7-[bis(2-trimethylsilylethoxymethyl)amino]-3-(6-fluoroquinolin-3-yl)pyrazolo[1,5-a]pyrimidin-5-yl]-1-methylcyclohexane-1-carboxylate |
| SMILES | CCOC(=O)C1(C)CCC(c2cc(N(COCC[Si](C)(C)C)COCC[Si](C)(C)C)n3ncc(-c4cnc5ccc(F)cc5c4)c3n2)CC1 |
| InChI | InChI=1S/C37H54FN5O4Si2/c1-9-47-36(44)37(2)14-12-27(13-15-37)33-22-34(42(25-45-16-18-48(3,4)5)26-46-17-19-49(6,7)8)43-35(41-33)31(24-40-43)29-20-28-21-30(38)10-11-32(28)39-23-29/h10-11,20-24,27H,9,12-19,25-26H2,1-8H3 |
| InChIKey | APSHZKPEEOAXIL-UHFFFAOYSA-N |
| XLogP | 8.74 |
| TPSA | 91.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.04 |
| LogP ≤ 5 | 8.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|