C30H34N6OSi — CID 67513853
2-[[6-[4-(3,4-dihydro-2H-quinolin-1-yl)quinazolin-6-yl]-2-methylimidazo[4,5-b]pyridin-3-yl]methoxy]ethyl-trimethylsilane (PubChem CID 67513853) has the molecular formula C30H34N6OSi and a molecular weight of 522.73 g/mol. Its IUPAC name is 2-[[6-[4-(3,4-dihydro-2H-quinolin-1-yl)quinazolin-6-yl]-2-methylimidazo[4,5-b]pyridin-3-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[6-[4-(3,4-dihydro-2H-quinolin-1-yl)quinazolin-6-yl]-2-methylimidazo[4,5-b]pyridin-3-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 67513853 |
| Molecular Formula | C30H34N6OSi |
| Molecular Weight | 522.73 g/mol |
| Exact Mass | 522.26 |
| IUPAC Name | 2-[[6-[4-(3,4-dihydro-2H-quinolin-1-yl)quinazolin-6-yl]-2-methylimidazo[4,5-b]pyridin-3-yl]methoxy]ethyl-trimethylsilane |
| SMILES | Cc1nc2cc(-c3ccc4ncnc(N5CCCc6ccccc65)c4c3)cnc2n1COCC[Si](C)(C)C |
| InChI | InChI=1S/C30H34N6OSi/c1-21-34-27-17-24(18-31-30(27)36(21)20-37-14-15-38(2,3)4)23-11-12-26-25(16-23)29(33-19-32-26)35-13-7-9-22-8-5-6-10-28(22)35/h5-6,8,10-12,16-19H,7,9,13-15,20H2,1-4H3 |
| InChIKey | VRGDJMOFCUBHED-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 68.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.73 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|