C29H31F2N5O6S — CID 67513911
4-[(3,3-difluoroazetidin-1-yl)methyl]-N-[3-[2-(3-hydroxypropoxy)-3,5-dimethoxyanilino]quinoxalin-2-yl]benzenesulfonamide (PubChem CID 67513911) has the molecular formula C29H31F2N5O6S and a molecular weight of 615.66 g/mol. Its IUPAC name is 4-[(3,3-difluoroazetidin-1-yl)methyl]-N-[3-[2-(3-hydroxypropoxy)-3,5-dimethoxyanilino]quinoxalin-2-yl]benzenesulfonamide.
| Compound Name | 4-[(3,3-difluoroazetidin-1-yl)methyl]-N-[3-[2-(3-hydroxypropoxy)-3,5-dimethoxyanilino]quinoxalin-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 67513911 |
| Molecular Formula | C29H31F2N5O6S |
| Molecular Weight | 615.66 g/mol |
| Exact Mass | 615.20 |
| IUPAC Name | 4-[(3,3-difluoroazetidin-1-yl)methyl]-N-[3-[2-(3-hydroxypropoxy)-3,5-dimethoxyanilino]quinoxalin-2-yl]benzenesulfonamide |
| SMILES | COc1cc(Nc2nc3ccccc3nc2NS(=O)(=O)c2ccc(CN3CC(F)(F)C3)cc2)c(OCCCO)c(OC)c1 |
| InChI | InChI=1S/C29H31F2N5O6S/c1-40-20-14-24(26(25(15-20)41-2)42-13-5-12-37)34-27-28(33-23-7-4-3-6-22(23)32-27)35-43(38,39)21-10-8-19(9-11-21)16-36-17-29(30,31)18-36/h3-4,6-11,14-15,37H,5,12-13,16-18H2,1-2H3,(H,32,34)(H,33,35) |
| InChIKey | PCMCZKDZXICPFV-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 135.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.66 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|