C42H61N5O4Si2 — CID 67514224
tert-butyl 4-[7-[bis(2-trimethylsilylethoxymethyl)amino]-6-ethenyl-3-(6-phenyl-3-pyridinyl)pyrazolo[1,5-a]pyrimidin-5-yl]cyclohexane-1-carboxylate (PubChem CID 67514224) has the molecular formula C42H61N5O4Si2 and a molecular weight of 756.15 g/mol. Its IUPAC name is tert-butyl 4-[7-[bis(2-trimethylsilylethoxymethyl)amino]-6-ethenyl-3-(6-phenyl-3-pyridinyl)pyrazolo[1,5-a]pyrimidin-5-yl]cyclohexane-1-carboxylate.
| Compound Name | tert-butyl 4-[7-[bis(2-trimethylsilylethoxymethyl)amino]-6-ethenyl-3-(6-phenyl-3-pyridinyl)pyrazolo[1,5-a]pyrimidin-5-yl]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 67514224 |
| Molecular Formula | C42H61N5O4Si2 |
| Molecular Weight | 756.15 g/mol |
| Exact Mass | 755.43 |
| IUPAC Name | tert-butyl 4-[7-[bis(2-trimethylsilylethoxymethyl)amino]-6-ethenyl-3-(6-phenyl-3-pyridinyl)pyrazolo[1,5-a]pyrimidin-5-yl]cyclohexane-1-carboxylate |
| SMILES | C=Cc1c(C2CCC(C(=O)OC(C)(C)C)CC2)nc2c(-c3ccc(-c4ccccc4)nc3)cnn2c1N(COCC[Si](C)(C)C)COCC[Si](C)(C)C |
| InChI | InChI=1S/C42H61N5O4Si2/c1-11-35-38(32-17-19-33(20-18-32)41(48)51-42(2,3)4)45-39-36(34-21-22-37(43-27-34)31-15-13-12-14-16-31)28-44-47(39)40(35)46(29-49-23-25-52(5,6)7)30-50-24-26-53(8,9)10/h11-16,21-22,27-28,32-33H,1,17-20,23-26,29-30H2,2-10H3 |
| InChIKey | SPLZSPHKOHNQBV-UHFFFAOYSA-N |
| XLogP | 10.15 |
| TPSA | 91.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 756.15 |
| LogP ≤ 5 | 10.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|