About 5-bromo-2,4,6-trimethoxypyrimidine
5-bromo-2,4,6-trimethoxypyrimidine (PubChem CID 67514371) has the molecular formula C7H9BrN2O3
and a molecular weight of 249.06 g/mol. Its IUPAC name is 5-bromo-2,4,6-trimethoxypyrimidine.
Molecular Properties
| Compound Name | 5-bromo-2,4,6-trimethoxypyrimidine |
| PubChem CID | 67514371 |
| Molecular Formula | C7H9BrN2O3 |
| Molecular Weight | 249.06 g/mol |
| Exact Mass | 247.98 |
| IUPAC Name | 5-bromo-2,4,6-trimethoxypyrimidine |
| SMILES | COc1nc(OC)c(Br)c(OC)n1 |
| InChI | InChI=1S/C7H9BrN2O3/c1-11-5-4(8)6(12-2)10-7(9-5)13-3/h1-3H3 |
| InChIKey | SLZRXWHDRCURAO-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 53.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.06 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-bromo-2,4,6-trimethoxypyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-2,4,6-trimethoxypyrimidine?
The IUPAC name of 5-bromo-2,4,6-trimethoxypyrimidine (CID 67514371) is 5-bromo-2,4,6-trimethoxypyrimidine.
What is the SMILES notation for 5-bromo-2,4,6-trimethoxypyrimidine?
The canonical SMILES for 5-bromo-2,4,6-trimethoxypyrimidine is COc1nc(OC)c(Br)c(OC)n1.
What is the InChIKey of 5-bromo-2,4,6-trimethoxypyrimidine?
The InChIKey is SLZRXWHDRCURAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9BrN2O3/c1-11-5-4(8)6(12-2)10-7(9-5)13-3/h1-3H3.
What are the key properties of 5-bromo-2,4,6-trimethoxypyrimidine?
5-bromo-2,4,6-trimethoxypyrimidine has a molecular weight of 249.06 g/mol, XLogP of 1.26, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-2,4,6-trimethoxypyrimidine is sourced from PubChem (CID 67514371), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).