C29H26F2N6O3S — CID 67514372
[3-[5-(2-amino-1-phenylpropan-2-yl)-1,3,4-oxadiazol-2-yl]-5-(1,3-oxazol-2-yl)phenyl]-[4,4-difluoro-2-(4-methyl-1,3-thiazol-2-yl)pyrrolidin-1-yl]methanone (PubChem CID 67514372) has the molecular formula C29H26F2N6O3S and a molecular weight of 576.63 g/mol. Its IUPAC name is [3-[5-(2-amino-1-phenylpropan-2-yl)-1,3,4-oxadiazol-2-yl]-5-(1,3-oxazol-2-yl)phenyl]-[4,4-difluoro-2-(4-methyl-1,3-thiazol-2-yl)pyrrolidin-1-yl]methanone.
| Compound Name | [3-[5-(2-amino-1-phenylpropan-2-yl)-1,3,4-oxadiazol-2-yl]-5-(1,3-oxazol-2-yl)phenyl]-[4,4-difluoro-2-(4-methyl-1,3-thiazol-2-yl)pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 67514372 |
| Molecular Formula | C29H26F2N6O3S |
| Molecular Weight | 576.63 g/mol |
| Exact Mass | 576.18 |
| IUPAC Name | [3-[5-(2-amino-1-phenylpropan-2-yl)-1,3,4-oxadiazol-2-yl]-5-(1,3-oxazol-2-yl)phenyl]-[4,4-difluoro-2-(4-methyl-1,3-thiazol-2-yl)pyrrolidin-1-yl]methanone |
| SMILES | Cc1csc(C2CC(F)(F)CN2C(=O)c2cc(-c3ncco3)cc(-c3nnc(C(C)(N)Cc4ccccc4)o3)c2)n1 |
| InChI | InChI=1S/C29H26F2N6O3S/c1-17-15-41-25(34-17)22-14-29(30,31)16-37(22)26(38)21-11-19(23-33-8-9-39-23)10-20(12-21)24-35-36-27(40-24)28(2,32)13-18-6-4-3-5-7-18/h3-12,15,22H,13-14,16,32H2,1-2H3 |
| InChIKey | FJYHTIAPAJBMRO-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 124.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.63 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |