C21H24N6OS — CID 67514837
N-[5-amino-2-(3-aminopiperidin-1-yl)phenyl]-2-(5-methyl-3-pyridinyl)-1,3-thiazole-4-carboxamide (PubChem CID 67514837) has the molecular formula C21H24N6OS and a molecular weight of 408.53 g/mol. Its IUPAC name is N-[5-amino-2-(3-aminopiperidin-1-yl)phenyl]-2-(5-methyl-3-pyridinyl)-1,3-thiazole-4-carboxamide.
| Compound Name | N-[5-amino-2-(3-aminopiperidin-1-yl)phenyl]-2-(5-methyl-3-pyridinyl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 67514837 |
| Molecular Formula | C21H24N6OS |
| Molecular Weight | 408.53 g/mol |
| Exact Mass | 408.17 |
| IUPAC Name | N-[5-amino-2-(3-aminopiperidin-1-yl)phenyl]-2-(5-methyl-3-pyridinyl)-1,3-thiazole-4-carboxamide |
| SMILES | Cc1cncc(-c2nc(C(=O)Nc3cc(N)ccc3N3CCCC(N)C3)cs2)c1 |
| InChI | InChI=1S/C21H24N6OS/c1-13-7-14(10-24-9-13)21-26-18(12-29-21)20(28)25-17-8-15(22)4-5-19(17)27-6-2-3-16(23)11-27/h4-5,7-10,12,16H,2-3,6,11,22-23H2,1H3,(H,25,28) |
| InChIKey | NXVXTYVPXVWCED-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 110.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.53 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|